The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-((1R,2S,3R)-3-hydroxy-2-(3-(hydroxy(1-propylcyclobutyl)methyl)phenyl)-5-oxocyclopentyl)heptanoic acid ID: ALA3972401
PubChem CID: 11955157
Max Phase: Preclinical
Molecular Formula: C26H38O5
Molecular Weight: 430.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC1(C(O)c2cccc([C@H]3[C@H](O)CC(=O)[C@@H]3CCCCCCC(=O)O)c2)CCC1
Standard InChI: InChI=1S/C26H38O5/c1-2-13-26(14-8-15-26)25(31)19-10-7-9-18(16-19)24-20(21(27)17-22(24)28)11-5-3-4-6-12-23(29)30/h7,9-10,16,20,22,24-25,28,31H,2-6,8,11-15,17H2,1H3,(H,29,30)/t20-,22+,24+,25?/m0/s1
Standard InChI Key: NVDLIRUYYFEISR-QYJPUHJCSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
15.1989 -5.6687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4890 -6.0732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8935 -6.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6034 -6.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3210 -3.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1381 -3.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3925 -3.0864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7296 -2.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0708 -3.0864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7283 -1.7871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8398 -4.5236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6177 -4.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2814 -5.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7602 -5.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5739 -5.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9065 -5.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4256 -4.4372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1701 -2.8350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7766 -3.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5541 -3.1312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7252 -2.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5027 -2.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6737 -1.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4513 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6223 -0.2310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0578 -1.5777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7190 -5.0080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0496 -4.2606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0134 -5.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4953 -6.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3078 -6.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
5 11 1 6
6 12 1 1
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
7 18 1 6
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
16 27 1 0
27 1 1 0
27 28 1 0
1 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.59Molecular Weight (Monoisotopic): 430.2719AlogP: 5.15#Rotatable Bonds: 12Polar Surface Area: 94.83Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.33CX Basic pKa: ┄CX LogP: 4.99CX LogD: 2.05Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: 1.30
References 1. (2010) Therapeutic compounds,