The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9422273, 12a ID: ALA3972583
PubChem CID: 56649302
Max Phase: Preclinical
Molecular Formula: C29H38F4N4O5S
Molecular Weight: 630.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCc1ccc(F)cc1CN1CCC[C@H]1c1nc(C(=O)NCCCCC2CCCCC2)co1)NS(=O)(=O)C(F)(F)F
Standard InChI: InChI=1S/C29H38F4N4O5S/c30-23-13-11-21(12-14-26(38)36-43(40,41)29(31,32)33)22(17-23)18-37-16-6-10-25(37)28-35-24(19-42-28)27(39)34-15-5-4-9-20-7-2-1-3-8-20/h11,13,17,19-20,25H,1-10,12,14-16,18H2,(H,34,39)(H,36,38)/t25-/m0/s1
Standard InChI Key: BJUUQOLZOPQZKM-VWLOTQADSA-N
Molfile:
RDKit 2D
43 46 0 0 1 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9336 3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8912 5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1894 6.0109 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.1917 4.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.2297 5.4127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1873 7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2253 8.1138 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.1850 8.7117 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.1470 8.1099 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3786 -3.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8371 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3371 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8056 -3.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2318 -3.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7843 -2.0253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.2794 -2.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6272 -3.6046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3470 -4.3862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0093 -4.1831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.9638 -3.4558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.2006 -5.6716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.5850 -6.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7763 -7.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.1608 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.3521 -9.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.7365 -10.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.9299 -11.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.3147 -12.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.5063 -11.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.3130 -10.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.9282 -9.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 2 0
11 13 2 0
11 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
5 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
24 25 1 1
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 2 0
28 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 37 1 0
18 43 2 0
43 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 630.70Molecular Weight (Monoisotopic): 630.2499AlogP: 5.53#Rotatable Bonds: 13Polar Surface Area: 121.61Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.06CX Basic pKa: 6.11CX LogP: 4.82CX LogD: 5.16Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.22Np Likeness Score: -0.77
References 1. (2016) Compounds act at multiple prostaglandin receptors giving a general anti-inflammatory response,