The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Chlorophenyl)-2-(4-((4,5-diphenyl-2-(3,4,5-trimethoxyphenyl)-1H-imidazol-1-yl)methyl)-1H-1,2,3-triazol-1-yl)acetamide ID: ALA3972604
PubChem CID: 134154515
Max Phase: Preclinical
Molecular Formula: C35H31ClN6O4
Molecular Weight: 635.12
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2Cc2cn(CC(=O)Nc3ccc(Cl)cc3)nn2)cc(OC)c1OC
Standard InChI: InChI=1S/C35H31ClN6O4/c1-44-29-18-25(19-30(45-2)34(29)46-3)35-38-32(23-10-6-4-7-11-23)33(24-12-8-5-9-13-24)42(35)21-28-20-41(40-39-28)22-31(43)37-27-16-14-26(36)15-17-27/h4-20H,21-22H2,1-3H3,(H,37,43)
Standard InChI Key: XZECKWDTGRQLGE-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
7.3767 -8.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1974 -8.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9010 -7.8674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0276 -9.2916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2028 -9.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8550 -10.1136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0319 -10.1825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5570 -9.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9079 -8.7580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7329 -8.6878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5464 -7.7240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1238 -6.9871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6842 -6.3896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4305 -6.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3317 -7.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1532 -6.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8459 -5.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6027 -4.2471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7638 -4.2427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5096 -5.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1706 -5.5101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7203 -5.2621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1147 -4.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3260 -4.9403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1423 -5.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7496 -6.3064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5365 -6.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2880 -3.5684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6222 -2.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1494 -2.1528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3240 -2.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9757 -2.9732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4489 -3.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6243 -5.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7758 -6.1132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5533 -6.3824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1764 -5.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0169 -5.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2395 -4.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6372 -4.4906 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4778 -3.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9506 -6.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5735 -5.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7069 -7.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4869 -7.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7346 -9.5724 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
4 5 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
11 15 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
17 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
20 22 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 2 0
19 28 1 0
17 34 1 0
16 21 1 0
14 16 1 0
2 11 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
40 41 1 0
38 40 1 0
42 43 1 0
37 42 1 0
44 45 1 0
36 44 1 0
8 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 635.12Molecular Weight (Monoisotopic): 634.2095AlogP: 6.84#Rotatable Bonds: 11Polar Surface Area: 105.32Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.23CX Basic pKa: 4.42CX LogP: 6.60CX LogD: 6.60Aromatic Rings: 6Heavy Atoms: 46QED Weighted: 0.17Np Likeness Score: -1.33
References 1. Wang G, Peng Z, Wang J, Li J, Li X.. (2016) Synthesis and biological evaluation of novel 2,4,5-triarylimidazole-1,2,3-triazole derivatives via click chemistry as α-glucosidase inhibitors., 26 (23): [PMID:27810241 ] [10.1016/j.bmcl.2016.10.057 ]