US9296728, 27

ID: ALA3972814

PubChem CID: 71667690

Max Phase: Preclinical

Molecular Formula: C24H17F2NO4

Molecular Weight: 421.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc2ccc(N(Cc3ccc(F)cc3)Cc3ccc(F)cc3)cc2oc1=O

Standard InChI:  InChI=1S/C24H17F2NO4/c25-18-6-1-15(2-7-18)13-27(14-16-3-8-19(26)9-4-16)20-10-5-17-11-21(23(28)29)24(30)31-22(17)12-20/h1-12H,13-14H2,(H,28,29)

Standard InChI Key:  QIMUJZXUWHPQCH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6387   -0.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8988    3.7486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1973    2.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1957    1.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4925    0.7411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4878   -0.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1865   -1.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1828   -2.7049    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8898   -0.7509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8944    0.7491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9004    5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6019    6.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    7.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3019    8.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0032    7.5011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0363    8.1007    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0037    6.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3030    5.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
 12 13  1  0
 13  4  1  0
 13 14  2  0
  9 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 17  1  0
 15 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 28 30  1  0
 30 31  2  0
 31 25  1  0
M  END

Associated Targets(non-human)

Slc16a1 Monocarboxylate transporter 1 (151 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.40Molecular Weight (Monoisotopic): 421.1126AlogP: 4.98#Rotatable Bonds: 6
Polar Surface Area: 70.75Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.12CX Basic pKa: 0.82CX LogP: 5.21CX LogD: 1.75
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -0.61

References

1.  (2016)  Therapeutic compounds, 

Source

Source(1):