The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9296728, 27 ID: ALA3972814
PubChem CID: 71667690
Max Phase: Preclinical
Molecular Formula: C24H17F2NO4
Molecular Weight: 421.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc2ccc(N(Cc3ccc(F)cc3)Cc3ccc(F)cc3)cc2oc1=O
Standard InChI: InChI=1S/C24H17F2NO4/c25-18-6-1-15(2-7-18)13-27(14-16-3-8-19(26)9-4-16)20-10-5-17-11-21(23(28)29)24(30)31-22(17)12-20/h1-12H,13-14H2,(H,28,29)
Standard InChI Key: QIMUJZXUWHPQCH-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6387 -0.8963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8988 3.7486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1973 2.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1957 1.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4925 0.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4878 -0.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1865 -1.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1828 -2.7049 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8898 -0.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8944 0.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9004 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6019 6.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6012 7.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3019 8.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0032 7.5011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0363 8.1007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0037 6.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3030 5.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
11 12 1 0
12 13 1 0
13 4 1 0
13 14 2 0
9 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
20 22 1 0
22 23 2 0
23 17 1 0
15 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
28 30 1 0
30 31 2 0
31 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.40Molecular Weight (Monoisotopic): 421.1126AlogP: 4.98#Rotatable Bonds: 6Polar Surface Area: 70.75Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.12CX Basic pKa: 0.82CX LogP: 5.21CX LogD: 1.75Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -0.61
References 1. (2016) Therapeutic compounds,