US8742113, 242

ID: ALA3972853

PubChem CID: 86766024

Max Phase: Preclinical

Molecular Formula: C18H15N3O2S

Molecular Weight: 337.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccsc1C/N=C1/CC(=O)/C(=C/c2c[nH]c3ncccc23)O1

Standard InChI:  InChI=1S/C18H15N3O2S/c1-11-4-6-24-16(11)10-20-17-8-14(22)15(23-17)7-12-9-21-18-13(12)3-2-5-19-18/h2-7,9H,8,10H2,1H3,(H,19,21)/b15-7-,20-17-

Standard InChI Key:  FCAACBXZSFTUBR-OERNRODHSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
    6.7743   -6.9538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4140   -8.0984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2997   -9.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4221  -10.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9940  -10.0667    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0067   -8.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7878   -7.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4196   -8.3208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2028   -7.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2222   -7.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1079   -6.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3079   -6.7011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2234   -5.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6890   -4.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1979   -5.9466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  2  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 15  1  0
 23 18  1  0
 13 24  1  0
 24  9  1  0
M  END

Associated Targets(Human)

CDC7 Tchem Cell division cycle 7-related protein kinase (1385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 337.40Molecular Weight (Monoisotopic): 337.0885AlogP: 3.86#Rotatable Bonds: 3
Polar Surface Area: 67.34Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.51CX Basic pKa: 3.29CX LogP: 3.58CX LogD: 3.54
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.74Np Likeness Score: -1.04

References

1.  (2014)  Furanone derivative, 

Source

Source(1):