US9394309, 5

ID: ALA3972985

PubChem CID: 136409114

Max Phase: Preclinical

Molecular Formula: C23H17F3N6O

Molecular Weight: 450.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1-n1ccn2nc(-c3cn[nH]c3)cc12

Standard InChI:  InChI=1S/C23H17F3N6O/c1-14-5-6-18(29-22(33)15-3-2-4-17(9-15)23(24,25)26)10-20(14)31-7-8-32-21(31)11-19(30-32)16-12-27-28-13-16/h2-13H,1H3,(H,27,28)(H,29,33)

Standard InChI Key:  RCWTUZGCUQHAMR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    3.6954   -1.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1265   -2.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9144   -3.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2029   -4.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7035   -4.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9889   -6.1624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5113   -6.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1398   -5.1822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2259   -7.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7253   -7.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4368   -8.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6489  -10.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1496  -10.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4381   -8.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3613  -11.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9299  -12.4552    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8381  -11.3628    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.2694  -12.4192    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.9157   -3.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6321   -2.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7115    0.3949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1750   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9615   -1.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6023   -1.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8565   -0.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9973   -1.6789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4236   -3.0648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9282   -2.9475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 13 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
  5 19  1  0
 19 20  2  0
 20  2  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 21  1  0
 28 24  1  0
 26 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  1  0
 33 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3972985

    ---

Associated Targets(Human)

TEK Tclin Tyrosine-protein kinase TIE-2 (3348 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.42Molecular Weight (Monoisotopic): 450.1416AlogP: 5.09#Rotatable Bonds: 4
Polar Surface Area: 80.01Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.94CX Basic pKa: 2.02CX LogP: 5.56CX LogD: 5.56
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -2.12

References

1.  (2016)  Substituted phenylimidazopyrazoles and their use, 

Source

Source(1):