5-(3-fluoro-4-(methylsulfonyl)phenyl)-2,2-dimethyl-4-(4-(trifluoromethyl)phenyl)furan-3(2H)-one

ID: ALA3973185

PubChem CID: 18386071

Max Phase: Preclinical

Molecular Formula: C20H16F4O4S

Molecular Weight: 428.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)OC(c2ccc(S(C)(=O)=O)c(F)c2)=C(c2ccc(C(F)(F)F)cc2)C1=O

Standard InChI:  InChI=1S/C20H16F4O4S/c1-19(2)18(25)16(11-4-7-13(8-5-11)20(22,23)24)17(28-19)12-6-9-15(14(21)10-12)29(3,26)27/h4-10H,1-3H3

Standard InChI Key:  FUOYQZSWJUMMPY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   24.2598  -29.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8554  -28.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4464  -29.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5452  -23.7658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5070  -24.5859    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.2363  -24.2089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1948  -27.9940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5182  -27.9878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2607  -27.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4444  -27.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2961  -28.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.9612  -26.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2905  -25.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8068  -25.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9937  -25.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6667  -25.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1525  -26.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7331  -26.5477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5474  -26.6286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0227  -25.9647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6849  -25.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8671  -25.1425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3954  -25.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6963  -24.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1348  -24.4048    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.1594  -24.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9729  -24.6328    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.8206  -23.8108    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.5628  -23.8430    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  2  1  0
  2  8  1  0
  8  9  1  0
  9 10  2  0
 10  7  1  0
  8 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 10 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  9 18  1  0
 15  5  1  0
  5 24  1  0
 14 25  1  0
 21 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
M  END

Associated Targets(non-human)

Ptgs2 Cyclooxygenase-2 (1939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ptgs1 Cyclooxygenase-1 (661 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 428.40Molecular Weight (Monoisotopic): 428.0705AlogP: 4.49#Rotatable Bonds: 3
Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.06CX LogD: 4.06
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: -0.47

References

1.  (2002)  4,5-diaryl-3(2H)-furanone derivatives as cyclooxygenase-2 inhibitors, 

Source