2-ethyl-2-methyl-5-(4-(methylsulfonyl)phenyl)-4-(5-methylthiophen-2-yl)furan-3(2H)-one

ID: ALA3973214

PubChem CID: 18385927

Max Phase: Preclinical

Molecular Formula: C19H20O4S2

Molecular Weight: 376.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(C)s2)C1=O

Standard InChI:  InChI=1S/C19H20O4S2/c1-5-19(3)18(20)16(15-11-6-12(2)24-15)17(23-19)13-7-9-14(10-8-13)25(4,21)22/h6-11H,5H2,1-4H3

Standard InChI Key:  LCZJDBPFUDKXOT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   17.5418   -0.7689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5036   -1.5890    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.2329   -1.2120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2564   -6.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8520   -5.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4430   -6.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1913   -4.9971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5148   -4.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2573   -4.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4410   -4.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2927   -5.2412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9578   -3.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2871   -2.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8034   -2.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9903   -2.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6633   -3.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1491   -3.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6929   -1.6807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7308   -3.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5480   -3.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7948   -2.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1301   -2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4726   -2.7698    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.1240   -1.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0736   -6.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  7  5  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10  7  1  0
  8 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 10 12  1  0
 15  2  1  0
  2 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
  9 19  1  0
 22 24  1  0
  4 25  1  0
M  END

Associated Targets(non-human)

Ptgs2 Cyclooxygenase-2 (1939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ptgs1 Cyclooxygenase-1 (661 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 376.50Molecular Weight (Monoisotopic): 376.0803AlogP: 4.10#Rotatable Bonds: 4
Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.12CX LogD: 4.12
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.81Np Likeness Score: -0.52

References

1.  (2002)  4,5-diaryl-3(2H)-furanone derivatives as cyclooxygenase-2 inhibitors, 

Source