The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((1R,2S,3R,5R)-5-chloro-2-(4-(cyclohexyl(hydroxy)methyl)phenyl)-3-hydroxycyclopentyl)butoxy)acetic acid ID: ALA3973644
PubChem CID: 11955273
Max Phase: Preclinical
Molecular Formula: C24H35ClO5
Molecular Weight: 438.99
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)COCCCC[C@@H]1[C@@H](c2ccc(C(O)C3CCCCC3)cc2)[C@H](O)C[C@H]1Cl
Standard InChI: InChI=1S/C24H35ClO5/c25-20-14-21(26)23(19(20)8-4-5-13-30-15-22(27)28)16-9-11-18(12-10-16)24(29)17-6-2-1-3-7-17/h9-12,17,19-21,23-24,26,29H,1-8,13-15H2,(H,27,28)/t19-,20+,21+,23+,24?/m0/s1
Standard InChI Key: ZHSBXMHCTCKQQU-NTXCDXHRSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
30.4630 -10.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2802 -10.3429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5346 -9.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8716 -9.0840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2129 -9.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8704 -8.2668 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.9819 -11.0034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7598 -11.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4234 -11.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9023 -12.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7160 -12.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0486 -11.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5677 -10.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3121 -9.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9187 -9.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6962 -9.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8672 -8.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6448 -8.5604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8158 -7.7613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5933 -7.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1965 -12.9872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8642 -13.7338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0527 -13.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7201 -14.5563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1973 -15.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0112 -15.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3478 -14.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0091 -12.9016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1999 -8.0575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7644 -6.7107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
4 6 1 1
1 7 1 6
2 8 1 1
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 14 1 6
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
11 21 1 0
21 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
21 28 1 0
20 29 2 0
20 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.99Molecular Weight (Monoisotopic): 438.2173AlogP: 4.64#Rotatable Bonds: 10Polar Surface Area: 86.99Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.87CX Basic pKa: ┄CX LogP: 4.02CX LogD: 0.79Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: 0.55
References 1. (2010) Therapeutic compounds,