US9150577, 31

ID: ALA3973806

PubChem CID: 68323504

Max Phase: Preclinical

Molecular Formula: C27H27N5O3

Molecular Weight: 469.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1cnn(Cc2ccccc2)c1)c1ccc2cc3n(c2c1)CC1(CCOCC1)CNC3=O

Standard InChI:  InChI=1S/C27H27N5O3/c33-25(30-22-14-29-31(16-22)15-19-4-2-1-3-5-19)21-7-6-20-12-24-26(34)28-17-27(8-10-35-11-9-27)18-32(24)23(20)13-21/h1-7,12-14,16H,8-11,15,17-18H2,(H,28,34)(H,30,33)

Standard InChI Key:  DXVCFVJKINIMEA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    2.7403   -7.6082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8869   -6.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4396   -7.1617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0590   -8.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3318   -9.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2421  -10.6377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2097  -11.0151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7599  -12.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2443  -12.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7973  -14.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2813  -14.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2124  -13.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6596  -11.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1756  -11.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0172   -9.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2675   -5.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7135   -4.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0908   -3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0226   -2.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0899   -0.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2896    1.8259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1800    0.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2985   -0.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9921   -2.4462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5673   -2.9151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4488   -1.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5767   -2.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1989   -4.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  7 15  1  0
 15  4  2  0
  2 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 26  1  0
 26 32  1  0
 32 33  1  0
 33 21  1  0
 33 34  1  0
 34 19  1  0
 34 35  2  0
 35 16  1  0
M  END

Associated Targets(Human)

RPS6KA2 Tchem Ribosomal protein S6 kinase alpha 2 (2184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.55Molecular Weight (Monoisotopic): 469.2114AlogP: 3.68#Rotatable Bonds: 4
Polar Surface Area: 90.18Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.25CX LogP: 2.57CX LogD: 2.57
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -1.32

References

1.  (2015)  Heterocyclic compounds containing an indole core, 

Source

Source(1):