6,7-dimethoxy-2-(4-methoxybenzylthio)-3-(2-methoxyphenyl)quinazolin-4(3H)-one

ID: ALA3973809

PubChem CID: 134153056

Max Phase: Preclinical

Molecular Formula: C25H24N2O5S

Molecular Weight: 464.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CSc2nc3cc(OC)c(OC)cc3c(=O)n2-c2ccccc2OC)cc1

Standard InChI:  InChI=1S/C25H24N2O5S/c1-29-17-11-9-16(10-12-17)15-33-25-26-19-14-23(32-4)22(31-3)13-18(19)24(28)27(25)20-7-5-6-8-21(20)30-2/h5-14H,15H2,1-4H3

Standard InChI Key:  WXYAGMBLAJCNIH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   68.5055  -21.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   68.5044  -22.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.2192  -22.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.2174  -21.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.9328  -21.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.9336  -22.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   70.6489  -22.7805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   71.3639  -22.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.3591  -21.5358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   70.6432  -21.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.0681  -21.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.7853  -21.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.4968  -21.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.4922  -20.2885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.7702  -19.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.0617  -20.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.0800  -22.7755    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   72.0832  -23.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.7992  -24.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.7991  -24.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.5143  -25.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.2282  -24.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.2223  -24.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.5065  -23.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   70.6389  -20.3036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   74.9448  -25.2380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   75.6571  -24.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   67.7910  -21.1340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   71.3436  -19.8929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   71.3363  -19.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   67.7896  -22.7856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   67.7908  -20.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   67.0755  -22.3726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 10 25  2  0
 22 26  1  0
 26 27  1  0
  1 28  1  0
 16 29  1  0
 29 30  1  0
  2 31  1  0
 28 32  1  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3973809

    ---

Associated Targets(non-human)

DHFR Dihydrofolate reductase (644 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.54Molecular Weight (Monoisotopic): 464.1406AlogP: 4.71#Rotatable Bonds: 8
Polar Surface Area: 71.81Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.02CX LogD: 5.02
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -1.20

References

1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI..  (2016)  Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates.,  26  (19): [PMID:27554444] [10.1016/j.bmcl.2016.08.022]

Source