1-benzyl-5-(7-(diethylamino)-2-oxo-2H-chromen-6-yl)-1H-pyrrole-2-carbonitrile

ID: ALA3974043

PubChem CID: 134154230

Max Phase: Preclinical

Molecular Formula: C25H23N3O2

Molecular Weight: 397.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)c1cc2oc(=O)ccc2cc1-c1ccc(C#N)n1Cc1ccccc1

Standard InChI:  InChI=1S/C25H23N3O2/c1-3-27(4-2)23-15-24-19(10-13-25(29)30-24)14-21(23)22-12-11-20(16-26)28(22)17-18-8-6-5-7-9-18/h5-15H,3-4,17H2,1-2H3

Standard InChI Key:  BSKNFIKTIOWYFC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    3.3416  -16.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3405  -17.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0485  -17.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0467  -16.2032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7554  -16.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7588  -17.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4711  -17.8411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1847  -17.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1813  -16.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4644  -16.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8935  -17.8345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6383  -16.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5525  -15.3916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7533  -15.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3448  -15.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8919  -16.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4209  -14.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0924  -13.7281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6325  -17.8396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9251  -17.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6318  -18.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2170  -17.8385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9238  -19.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1597  -14.8448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9897  -14.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6002  -13.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4306  -12.7027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6527  -12.4496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0441  -13.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2168  -13.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  8 11  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  2  0
  1 12  1  0
 14 17  1  0
 17 18  3  0
  2 19  1  0
 19 20  1  0
 19 21  1  0
 20 22  1  0
 21 23  1  0
 13 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3974043

    ---

Associated Targets(Human)

PGR Tclin Progesterone receptor (8562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.48Molecular Weight (Monoisotopic): 397.1790AlogP: 5.03#Rotatable Bonds: 6
Polar Surface Area: 62.17Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.15CX LogP: 4.98CX LogD: 4.98
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -0.59

References

1. Kinoshita M, Negishi M, Sakai H, Hirano T, Mori S, Fujii S, Kagechika H, Tanatani A..  (2016)  Development of 6-arylcoumarins as nonsteroidal progesterone antagonists. Structure-activity relationships and fluorescence properties.,  24  (21): [PMID:27665178] [10.1016/j.bmc.2016.09.020]

Source