The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9328118, 50 ID: ALA3974360
PubChem CID: 117899605
Max Phase: Preclinical
Molecular Formula: C21H21F3N6O
Molecular Weight: 430.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cn1ccc2c(-c3cnc(OCCC4CCCNC4)c(C(F)(F)F)c3)nc(C#N)nc21
Standard InChI: InChI=1S/C21H21F3N6O/c1-30-7-4-15-18(28-17(10-25)29-19(15)30)14-9-16(21(22,23)24)20(27-12-14)31-8-5-13-3-2-6-26-11-13/h4,7,9,12-13,26H,2-3,5-6,8,11H2,1H3
Standard InChI Key: IDMNQUXXECIBQS-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6380 2.1004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 1.5046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 3.7544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7945 3.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0946 3.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3945 3.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6950 3.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9926 2.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9898 1.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6894 0.7513 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3917 1.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5964 3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8919 5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9298 5.8556 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8515 5.8513 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8894 6.4533 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 2 1 0
10 5 1 0
8 11 1 0
11 12 3 0
6 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 20 1 0
16 26 1 0
26 27 2 0
27 13 1 0
26 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.43Molecular Weight (Monoisotopic): 430.1729AlogP: 3.69#Rotatable Bonds: 5Polar Surface Area: 88.65Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.49CX LogP: 3.90CX LogD: 0.99Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -0.93
References 1. (2016) Nitrogen-containing bicyclic aromatic heterocyclic compound,