US9428478, TG6-191

ID: ALA3974678

PubChem CID: 71116219

Max Phase: Preclinical

Molecular Formula: C21H20FN3O3

Molecular Weight: 381.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(N2CCN(C(=O)c3cnc4ccc(F)cc4c3O)CC2)cc1

Standard InChI:  InChI=1S/C21H20FN3O3/c1-28-16-5-3-15(4-6-16)24-8-10-25(11-9-24)21(27)18-13-23-19-7-2-14(22)12-17(19)20(18)26/h2-7,12-13H,8-11H2,1H3,(H,23,26)

Standard InChI Key:  PVFLTUINNSAWMH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   11.6663    4.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6740    3.7912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3796    3.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3872    1.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0920    0.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7891    1.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7816    3.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0768    3.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9363   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14  9  1  0
 12 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 25 26  1  0
 26 20  1  0
 26 27  2  0
 27 17  1  0
 27 28  1  0
M  END

Associated Targets(Human)

CYBB Tchem Cytochrome b-245 heavy chain (193 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 381.41Molecular Weight (Monoisotopic): 381.1489AlogP: 3.05#Rotatable Bonds: 3
Polar Surface Area: 65.90Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.86CX Basic pKa: 3.99CX LogP: 3.50CX LogD: 3.48
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.76Np Likeness Score: -1.52

References

1.  (2016)  Piperazine derivatives, compositions, and uses related thereto, 

Source

Source(1):