The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9452980, 40 ID: ALA3974740
PubChem CID: 69937783
Max Phase: Preclinical
Molecular Formula: C25H26ClN3O
Molecular Weight: 419.96
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(c2ccc(NC(=O)Nc3cccc(Cl)c3)cc2)CCN(Cc2ccccc2)C1
Standard InChI: InChI=1S/C25H26ClN3O/c1-25(14-15-29(18-25)17-19-6-3-2-4-7-19)20-10-12-22(13-11-20)27-24(30)28-23-9-5-8-21(26)16-23/h2-13,16H,14-15,17-18H2,1H3,(H2,27,28,30)
Standard InChI Key: ZLWIWELYILHASJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
2.3378 -6.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3607 -5.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5430 -6.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0317 -6.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6166 -4.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1057 -4.5497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6890 -3.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9643 -2.2104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.1781 -2.9796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.7613 -1.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.2494 -1.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8295 -0.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.9216 1.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4336 0.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7073 1.9359 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.8535 -0.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7129 -3.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2242 -3.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 13 1 0
13 2 1 0
2 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
26 28 2 0
28 22 1 0
17 29 1 0
29 30 2 0
30 14 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.96Molecular Weight (Monoisotopic): 419.1764AlogP: 6.15#Rotatable Bonds: 5Polar Surface Area: 44.37Molecular Species: BASEHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.46CX Basic pKa: 9.55CX LogP: 5.95CX LogD: 3.81Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -1.17
References 1. (2016) Substituted benzamides,