US9452980, 40

ID: ALA3974740

PubChem CID: 69937783

Max Phase: Preclinical

Molecular Formula: C25H26ClN3O

Molecular Weight: 419.96

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(c2ccc(NC(=O)Nc3cccc(Cl)c3)cc2)CCN(Cc2ccccc2)C1

Standard InChI:  InChI=1S/C25H26ClN3O/c1-25(14-15-29(18-25)17-19-6-3-2-4-7-19)20-10-12-22(13-11-20)27-24(30)28-23-9-5-8-21(26)16-23/h2-13,16H,14-15,17-18H2,1H3,(H2,27,28,30)

Standard InChI Key:  ZLWIWELYILHASJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    2.3378   -6.3783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3607   -5.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5430   -6.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0317   -6.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6166   -4.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1057   -4.5497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6890   -3.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9643   -2.2104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1781   -2.9796    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7613   -1.5967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2494   -1.4074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8295   -0.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9216    1.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4336    0.9807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7073    1.9359    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.8535   -0.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7129   -3.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2242   -3.7239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5 13  1  0
 13  2  1  0
  2 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 28 22  1  0
 17 29  1  0
 29 30  2  0
 30 14  1  0
M  END

Associated Targets(non-human)

Taar1 Trace amine-associated receptor 1 (899 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.96Molecular Weight (Monoisotopic): 419.1764AlogP: 6.15#Rotatable Bonds: 5
Polar Surface Area: 44.37Molecular Species: BASEHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.46CX Basic pKa: 9.55CX LogP: 5.95CX LogD: 3.81
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.52Np Likeness Score: -1.17

References

1.  (2016)  Substituted benzamides, 

Source

Source(1):