US9163007, 167

ID: ALA3974914

PubChem CID: 68737316

Max Phase: Preclinical

Molecular Formula: C21H20FN5O

Molecular Weight: 377.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1ccc(-c2c(-c3ccc4[nH]ncc4c3)nnn2CC2CCOCC2)cc1

Standard InChI:  InChI=1S/C21H20FN5O/c22-18-4-1-15(2-5-18)21-20(16-3-6-19-17(11-16)12-23-24-19)25-26-27(21)13-14-7-9-28-10-8-14/h1-6,11-12,14H,7-10,13H2,(H,23,24)

Standard InChI Key:  WWKXHAYLEYNBPR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    5.4389    4.6145    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1020    3.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6446    3.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2235    1.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2568    0.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7171    0.9385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1382    2.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511   -0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4437   -1.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3221   -3.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8147   -2.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6903   -4.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0732   -5.4995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5807   -5.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7051   -4.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 14  1  0
  9 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
 27 28  2  0
 28 20  1  0
M  END

Associated Targets(Human)

CDC7 Tchem Cell division cycle 7-related protein kinase (1385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.42Molecular Weight (Monoisotopic): 377.1652AlogP: 4.05#Rotatable Bonds: 4
Polar Surface Area: 68.62Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.38CX Basic pKa: 1.64CX LogP: 3.51CX LogD: 3.51
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.58Np Likeness Score: -1.73

References

1.  (2015)  5-substituted indazoles as kinase inhibitors, 

Source

Source(1):