5-(6-Chloro-8-(((2-ethylpyridin-4-yl)methyl)amino)-2-methylimidazo[1,2-b]pyridazin-3-yl)-2-methoxy-N-(prop-2-yn-1-yl)-benzenesulfonamide

ID: ALA3974986

PubChem CID: 134153378

Max Phase: Preclinical

Molecular Formula: C25H25ClN6O3S

Molecular Weight: 525.03

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C#CCNS(=O)(=O)c1cc(-c2c(C)nc3c(NCc4ccnc(CC)c4)cc(Cl)nn23)ccc1OC

Standard InChI:  InChI=1S/C25H25ClN6O3S/c1-5-10-29-36(33,34)22-13-18(7-8-21(22)35-4)24-16(3)30-25-20(14-23(26)31-32(24)25)28-15-17-9-11-27-19(6-2)12-17/h1,7-9,11-14,28-29H,6,10,15H2,2-4H3

Standard InChI Key:  LPGHLFVYKKJTMH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    6.9337   -8.2462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9379   -9.0634    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.6435   -8.6512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1390   -8.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5884   -9.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7896   -9.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5332   -8.5572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0838   -7.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8826   -8.1184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3692   -9.7661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1862   -9.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6153  -10.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0443  -11.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8448  -10.2877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2983  -10.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0477   -6.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3336   -5.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6254   -6.0976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6273   -6.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3373   -7.3260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0455   -6.9158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8244   -5.8422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3102   -6.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8274   -7.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1274   -6.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3318   -4.8661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6218   -4.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3304   -2.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3322   -3.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6241   -3.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9099   -3.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9081   -2.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6204   -1.9993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0386   -1.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0367   -1.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9191   -7.3291    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  2 10  1  0
  4  2  1  0
 11 12  1  0
 12 13  3  0
 10 11  1  0
 14 15  1  0
  5 14  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  1  0
 22 23  1  0
 23 24  2  0
 21 24  1  0
 16 22  2  0
 23 25  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 28 33  2  0
 34 35  1  0
 28 34  1  0
 27 30  1  0
 26 27  1  0
 17 26  1  0
 19 36  1  0
  8 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3974986

    ---

Associated Targets(Human)

PI4KB Tchem PI4-kinase beta subunit (1593 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.03Molecular Weight (Monoisotopic): 524.1397AlogP: 3.85#Rotatable Bonds: 9
Polar Surface Area: 110.51Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.44CX Basic pKa: 5.55CX LogP: 2.89CX LogD: 2.88
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -1.63

References

1. Humpolickova J, Mejdrová I, Matousova M, Nencka R, Boura E..  (2017)  Fluorescent Inhibitors as Tools To Characterize Enzymes: Case Study of the Lipid Kinase Phosphatidylinositol 4-Kinase IIIβ (PI4KB).,  60  (1): [PMID:28004946] [10.1021/acs.jmedchem.6b01466]

Source