The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9447055, I ID: ALA3975522
Cas Number: 2005486-31-5
PubChem CID: 122522051
Product Number: E647754, Order Now?
Max Phase: Phase
Molecular Formula: C30H34FN3O5S2
Molecular Weight: 599.75
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Ebopiprant | Obe022 | OBE-022 | OBE022
Canonical SMILES: CC(C)[C@H](N)C(=O)OCC[C@H](NC(=O)[C@@H]1SCCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1)c1ccc(F)cc1
Standard InChI: InChI=1S/C30H34FN3O5S2/c1-20(2)27(32)30(36)39-18-16-26(23-8-12-24(31)13-9-23)33-28(35)29-34(17-19-40-29)41(37,38)25-14-10-22(11-15-25)21-6-4-3-5-7-21/h3-15,20,26-27,29H,16-19,32H2,1-2H3,(H,33,35)/t26-,27-,29-/m0/s1
Standard InChI Key: UUIBKACUTXYSAK-YCVJPRETSA-N
Molfile:
L-Valine, (3S)-3-[[[(2S)-3-([1,1'-biphenyl]-4-ylsulfonyl)-2-thiazolidinyl]car...
RDKit 2D
41 44 0 0 1 0 0 0 0 0999 V2000
16.4948 -3.2721 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.6263 -2.4577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6803 -3.1406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3633 -4.0865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6271 -4.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8931 -4.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1999 -4.5293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4659 -4.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4252 -3.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6913 -2.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9980 -3.3991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2640 -3.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5709 -3.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8369 -3.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1436 -3.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7962 -2.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6116 -4.2936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2234 -2.1984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7727 -4.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8135 -5.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1202 -5.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3862 -5.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3455 -4.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0387 -4.2232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6929 -5.9416 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.8524 -3.2581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7537 -5.2741 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.5681 -5.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9449 -4.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3092 -3.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8304 -2.7640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6447 -2.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9381 -3.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4171 -4.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6025 -4.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7526 -3.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2736 -3.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0881 -3.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3815 -4.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8603 -4.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0459 -4.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 2 0
1 4 1 0
4 5 1 0
5 6 1 1
6 7 1 0
7 8 1 0
8 9 1 6
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
13 17 1 1
12 18 2 0
8 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
23 22 1 0
24 23 2 0
19 24 1 0
22 25 1 0
6 26 2 0
5 27 1 0
27 28 1 0
29 28 1 0
4 29 1 0
1 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
34 33 1 0
35 34 2 0
30 35 1 0
33 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
40 39 1 0
41 40 2 0
36 41 1 0
M END
Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: YesAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 599.75Molecular Weight (Monoisotopic): 599.1924AlogP: 4.33#Rotatable Bonds: 11Polar Surface Area: 118.80Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.72CX Basic pKa: 7.48CX LogP: 4.55CX LogD: 4.21Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.32Np Likeness Score: -0.82
References 1. (2016) α-amino esters of hydroxypropylthiazolidine carboxamide derivative and salt form, crystal polymorph thereof, 2. Unpublished dataset,