The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-chloro-5-(4-(4-(isopropylthio)phenylsulfonyl)piperazin-1-yl)phenoxy)acetic acid ID: ALA3975700
PubChem CID: 59232263
Max Phase: Preclinical
Molecular Formula: C21H25ClN2O5S2
Molecular Weight: 485.03
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Sc1ccc(S(=O)(=O)N2CCN(c3ccc(Cl)c(OCC(=O)O)c3)CC2)cc1
Standard InChI: InChI=1S/C21H25ClN2O5S2/c1-15(2)30-17-4-6-18(7-5-17)31(27,28)24-11-9-23(10-12-24)16-3-8-19(22)20(13-16)29-14-21(25)26/h3-8,13,15H,9-12,14H2,1-2H3,(H,25,26)
Standard InChI Key: JDDNRTYTJOLZBD-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
16.8639 -0.3632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2766 -1.0731 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.6850 -0.3607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0406 -2.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0395 -3.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7475 -3.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4572 -3.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4544 -2.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7457 -2.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1580 -2.3009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8671 -2.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5712 -2.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5723 -1.4837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8632 -1.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1530 -1.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3314 -3.9433 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.7473 -4.7614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0395 -5.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0393 -5.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3315 -6.3954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7469 -6.3958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9877 -1.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9837 -2.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6906 -2.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3993 -2.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3966 -1.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6892 -1.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1075 -2.7075 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.8147 -2.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5229 -2.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8136 -1.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
8 10 1 0
5 16 1 0
6 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
13 2 1 0
2 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.03Molecular Weight (Monoisotopic): 484.0893AlogP: 3.81#Rotatable Bonds: 8Polar Surface Area: 87.15Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.66CX Basic pKa: 0.96CX LogP: 3.88CX LogD: 0.56Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: -2.03
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,