2,2-dimethyl-5-(4-(methylsulfonyl)phenyl)-4-m-tolylfuran-3(2H)-one

ID: ALA3975911

PubChem CID: 18386006

Max Phase: Preclinical

Molecular Formula: C20H20O4S

Molecular Weight: 356.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C2=C(c3ccc(S(C)(=O)=O)cc3)OC(C)(C)C2=O)c1

Standard InChI:  InChI=1S/C20H20O4S/c1-13-6-5-7-15(12-13)17-18(24-20(2,3)19(17)21)14-8-10-16(11-9-14)25(4,22)23/h5-12H,1-4H3

Standard InChI Key:  FAKOKFQFCDOHKL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   25.1465  -24.0330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9338  -24.8336    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.7335  -24.6175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6944  -29.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2858  -28.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8726  -29.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6210  -28.2860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9582  -28.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7022  -27.4992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8774  -27.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7428  -28.5440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3934  -26.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7303  -26.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2451  -25.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4230  -25.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0886  -26.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5758  -26.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1152  -24.9254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1830  -26.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0052  -26.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4891  -26.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1519  -25.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3259  -25.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8458  -26.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3104  -26.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  7  5  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10  7  1  0
  8 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 10 12  1  0
 15  2  1  0
  2 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  9 19  1  0
 21 25  1  0
M  END

Associated Targets(non-human)

Ptgs2 Cyclooxygenase-2 (1939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ptgs1 Cyclooxygenase-1 (661 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 356.44Molecular Weight (Monoisotopic): 356.1082AlogP: 3.64#Rotatable Bonds: 3
Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.55CX LogD: 3.55
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.84Np Likeness Score: -0.25

References

1.  (2002)  4,5-diaryl-3(2H)-furanone derivatives as cyclooxygenase-2 inhibitors, 

Source