US9173869, 49

ID: ALA3976300

PubChem CID: 4288143

Max Phase: Preclinical

Molecular Formula: C25H31ClN2O3

Molecular Weight: 442.99

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(C)N(CCC(=O)NC1CCCc2ccccc21)C(=O)COc1ccc(Cl)cc1

Standard InChI:  InChI=1S/C25H31ClN2O3/c1-3-18(2)28(25(30)17-31-21-13-11-20(26)12-14-21)16-15-24(29)27-23-10-6-8-19-7-4-5-9-22(19)23/h4-5,7,9,11-14,18,23H,3,6,8,10,15-17H2,1-2H3,(H,27,29)

Standard InChI Key:  ONHNEDLWTCREAL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    6.4999   -4.9403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5003   -3.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7998   -2.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8391   -3.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -1.4887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8969    0.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0990   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0969    0.4636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4003   -1.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6990   -0.7319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0002   -1.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2993   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5984   -1.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5984   -2.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6377   -3.5796    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.2994   -3.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0004   -2.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 11  1  0
 20 15  1  0
  5 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 28 30  1  0
 30 31  2  0
 31 25  1  0
M  END

Associated Targets(non-human)

Shh Sonic hedgehog protein (356 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.99Molecular Weight (Monoisotopic): 442.2023AlogP: 4.93#Rotatable Bonds: 9
Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.68CX LogD: 4.68
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -1.36

References

1.  (2015)  Mediators of hedgehog signaling pathways, compositions and uses related thereto, 

Source

Source(1):