2-Phenoxy-N-[4-(thiazol-2-ylsulfamoyl)-naphthalen-1-yl]-acetamide

ID: ALA3976615

PubChem CID: 16051135

Max Phase: Preclinical

Molecular Formula: C21H17N3O4S2

Molecular Weight: 439.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(COc1ccccc1)Nc1ccc(S(=O)(=O)Nc2nccs2)c2ccccc12

Standard InChI:  InChI=1S/C21H17N3O4S2/c25-20(14-28-15-6-2-1-3-7-15)23-18-10-11-19(17-9-5-4-8-16(17)18)30(26,27)24-21-22-12-13-29-21/h1-13H,14H2,(H,22,24)(H,23,25)

Standard InChI Key:  SDCQWRYGVULXRA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    7.2581   -4.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2581   -5.1172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9617   -5.5246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9617   -6.3396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6683   -6.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6683   -7.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9644   -7.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2538   -7.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2538   -6.7496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9644   -8.7857    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.6680   -9.1932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6680  -10.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3920  -10.4257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2053  -11.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3923  -11.3398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0587  -10.5706    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.1472   -8.7857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5558   -9.4928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3769   -7.9719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0780   -7.5613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0780   -6.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3719   -6.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5503   -5.5246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5503   -3.8947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5503   -3.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8479   -2.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8479   -1.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5518   -1.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2625   -1.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2625   -2.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
  4  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 13 12  2  0
 13 14  1  0
 14 15  2  0
 16 15  1  0
 12 16  1  0
 10 17  2  0
 10 18  2  0
  6 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
  5 22  1  0
  2 23  2  0
  1 24  1  0
 24 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
M  END

Associated Targets(non-human)

Scn11a Voltage-gated sodium channel (36 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 439.52Molecular Weight (Monoisotopic): 439.0660AlogP: 4.11#Rotatable Bonds: 7
Polar Surface Area: 97.39Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.68CX Basic pKa: 0.59CX LogP: 3.55CX LogD: 2.96
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.45Np Likeness Score: -2.03

References

1.  (2012)  Bicyclic derivatives as modulators of voltage gated ion channels, 

Source