The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Phenoxy-N-[4-(thiazol-2-ylsulfamoyl)-naphthalen-1-yl]-acetamide ID: ALA3976615
PubChem CID: 16051135
Max Phase: Preclinical
Molecular Formula: C21H17N3O4S2
Molecular Weight: 439.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1ccccc1)Nc1ccc(S(=O)(=O)Nc2nccs2)c2ccccc12
Standard InChI: InChI=1S/C21H17N3O4S2/c25-20(14-28-15-6-2-1-3-7-15)23-18-10-11-19(17-9-5-4-8-16(17)18)30(26,27)24-21-22-12-13-29-21/h1-13H,14H2,(H,22,24)(H,23,25)
Standard InChI Key: SDCQWRYGVULXRA-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
7.2581 -4.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2581 -5.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9617 -5.5246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9617 -6.3396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6683 -6.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6683 -7.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9644 -7.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2538 -7.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2538 -6.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9644 -8.7857 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6680 -9.1932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6680 -10.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3920 -10.4257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2053 -11.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3923 -11.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0587 -10.5706 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.1472 -8.7857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5558 -9.4928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3769 -7.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0780 -7.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0780 -6.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3719 -6.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5503 -5.5246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5503 -3.8947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5503 -3.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8479 -2.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8479 -1.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5518 -1.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2625 -1.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2625 -2.6697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 2 0
6 5 1 0
7 6 2 0
8 7 1 0
9 8 2 0
4 9 1 0
7 10 1 0
10 11 1 0
11 12 1 0
13 12 2 0
13 14 1 0
14 15 2 0
16 15 1 0
12 16 1 0
10 17 2 0
10 18 2 0
6 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
5 22 1 0
2 23 2 0
1 24 1 0
24 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.52Molecular Weight (Monoisotopic): 439.0660AlogP: 4.11#Rotatable Bonds: 7Polar Surface Area: 97.39Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.68CX Basic pKa: 0.59CX LogP: 3.55CX LogD: 2.96Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.45Np Likeness Score: -2.03
References 1. (2012) Bicyclic derivatives as modulators of voltage gated ion channels,