4-(4-tert-butylphenyl)-2,2-dimethyl-5-(4-(methylsulfonyl)phenyl)furan-3(2H)-one

ID: ALA3976673

PubChem CID: 18385637

Max Phase: Preclinical

Molecular Formula: C23H26O4S

Molecular Weight: 398.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(C(C)(C)C)cc2)C1=O

Standard InChI:  InChI=1S/C23H26O4S/c1-22(2,3)17-11-7-15(8-12-17)19-20(27-23(4,5)21(19)24)16-9-13-18(14-10-16)28(6,25)26/h7-14H,1-6H3

Standard InChI Key:  YEOFGRCGUIPWRA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   16.5003   -1.0042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2877   -1.8042    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.0868   -1.5883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0462   -6.4501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6378   -5.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2249   -6.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9735   -5.2537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3097   -5.2545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0540   -4.4675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2299   -4.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0937   -5.5115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7462   -3.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0828   -3.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5980   -2.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7767   -2.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4424   -3.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9293   -3.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5342   -3.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3559   -3.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8393   -3.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5023   -2.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6772   -2.3820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1973   -3.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4699   -1.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9851   -1.7953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8059   -1.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6470   -1.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3920   -1.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  7  5  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10  7  1  0
  8 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 10 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  9 18  1  0
 15  2  1  0
  2 24  1  0
 21 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
M  END

Associated Targets(non-human)

Ptgs2 Cyclooxygenase-2 (1939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ptgs1 Cyclooxygenase-1 (661 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 398.52Molecular Weight (Monoisotopic): 398.1552AlogP: 4.63#Rotatable Bonds: 3
Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.58CX LogD: 4.58
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.76Np Likeness Score: -0.19

References

1.  (2002)  4,5-diaryl-3(2H)-furanone derivatives as cyclooxygenase-2 inhibitors, 

Source