The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394309, 63 ID: ALA3977173
PubChem CID: 89699935
Max Phase: Preclinical
Molecular Formula: C26H23N5O3
Molecular Weight: 453.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)cc(C(=O)Nc2ccc(C)c(-n3ccn4nc(-c5cccnc5)cc34)c2)c1
Standard InChI: InChI=1S/C26H23N5O3/c1-17-6-7-20(28-26(32)19-11-21(33-2)14-22(12-19)34-3)13-24(17)30-9-10-31-25(30)15-23(29-31)18-5-4-8-27-16-18/h4-16H,1-3H3,(H,28,32)
Standard InChI Key: ORZYTZBSPPUODW-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
0.8407 -11.3598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3587 -11.3968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1496 -10.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6490 -10.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4368 -8.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9371 -8.9299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5659 -7.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7253 -7.5684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2259 -7.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4381 -8.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5113 -6.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1398 -5.1822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9889 -6.1624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7035 -4.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2029 -4.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9144 -3.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1265 -2.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6954 -1.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6321 -2.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9157 -3.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6023 -1.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7850 -0.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1726 -1.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3732 -2.6369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1861 -3.5538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7984 -2.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
5 8 2 0
8 9 1 0
9 10 2 0
10 3 1 0
9 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
17 19 1 0
19 20 2 0
20 14 1 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 21 1 0
28 24 1 0
26 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.50Molecular Weight (Monoisotopic): 453.1801AlogP: 4.76#Rotatable Bonds: 6Polar Surface Area: 82.68Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.17CX LogP: 4.85CX LogD: 4.85Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.64
References 1. (2016) Substituted phenylimidazopyrazoles and their use,