US9394309, 63

ID: ALA3977173

PubChem CID: 89699935

Max Phase: Preclinical

Molecular Formula: C26H23N5O3

Molecular Weight: 453.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(OC)cc(C(=O)Nc2ccc(C)c(-n3ccn4nc(-c5cccnc5)cc34)c2)c1

Standard InChI:  InChI=1S/C26H23N5O3/c1-17-6-7-20(28-26(32)19-11-21(33-2)14-22(12-19)34-3)13-24(17)30-9-10-31-25(30)15-23(29-31)18-5-4-8-27-16-18/h4-16H,1-3H3,(H,28,32)

Standard InChI Key:  ORZYTZBSPPUODW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    0.8407  -11.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3587  -11.3968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1496  -10.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6490  -10.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4368   -8.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9371   -8.9299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5659   -7.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7253   -7.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2259   -7.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4381   -8.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5113   -6.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1398   -5.1822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9889   -6.1624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7035   -4.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2029   -4.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9144   -3.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1265   -2.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6954   -1.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6321   -2.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9157   -3.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7115    0.3949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1750   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9615   -1.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6023   -1.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7850   -0.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1726   -1.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3732   -2.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1861   -3.5538    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7984   -2.9843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  5  8  2  0
  8  9  1  0
  9 10  2  0
 10  3  1  0
  9 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 17 19  1  0
 19 20  2  0
 20 14  1  0
 19 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 21  1  0
 28 24  1  0
 26 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Associated Targets(Human)

TEK Tclin Tyrosine-protein kinase TIE-2 (3348 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.50Molecular Weight (Monoisotopic): 453.1801AlogP: 4.76#Rotatable Bonds: 6
Polar Surface Area: 82.68Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.17CX LogP: 4.85CX LogD: 4.85
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.64

References

1.  (2016)  Substituted phenylimidazopyrazoles and their use, 

Source

Source(1):