US9428478, TG2-171-1

ID: ALA3978208

PubChem CID: 24178263

Max Phase: Preclinical

Molecular Formula: C20H23N3O3

Molecular Weight: 353.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)c1ccc(NCC(=O)N2CCN(c3ccccc3O)CC2)cc1

Standard InChI:  InChI=1S/C20H23N3O3/c1-15(24)16-6-8-17(9-7-16)21-14-20(26)23-12-10-22(11-13-23)18-4-2-3-5-19(18)25/h2-9,21,25H,10-14H2,1H3

Standard InChI Key:  ZJDIVFMFAZLGTM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    3.6375   -0.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5956   -2.7031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2024    2.6932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4990    0.7409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8007    1.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0971    0.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0919   -0.7681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7903   -1.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4939   -0.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3890   -1.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3815   -3.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6768   -3.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9796   -3.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9872   -1.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6919   -0.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6980    0.4204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 12  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
  7 25  1  0
 25 26  2  0
 26  4  1  0
M  END

Associated Targets(Human)

CYBB Tchem Cytochrome b-245 heavy chain (193 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XDH Tclin Xanthine dehydrogenase (1038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.42Molecular Weight (Monoisotopic): 353.1739AlogP: 2.36#Rotatable Bonds: 5
Polar Surface Area: 72.88Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.20CX Basic pKa: 2.39CX LogP: 1.56CX LogD: 1.56
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.81Np Likeness Score: -1.30

References

1.  (2016)  Piperazine derivatives, compositions, and uses related thereto, 

Source

Source(1):