US9296728, 10

ID: ALA3978307

PubChem CID: 71667418

Max Phase: Preclinical

Molecular Formula: C24H20N2O2

Molecular Weight: 368.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#C/C(=C\c1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1)C(=O)O

Standard InChI:  InChI=1S/C24H20N2O2/c25-16-22(24(27)28)15-19-11-13-23(14-12-19)26(17-20-7-3-1-4-8-20)18-21-9-5-2-6-10-21/h1-15H,17-18H2,(H,27,28)/b22-15+

Standard InChI Key:  HVZSJLIGRHWSJP-PXLXIMEGSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    0.2564   -3.1547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2956   -3.7547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2952   -4.9547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8976   -0.7537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9019    0.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2031    1.4926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4999    0.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4957   -0.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -1.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8028    1.4838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0991    0.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0933   -0.7733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3879   -1.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3790   -3.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0755   -3.7733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7810   -3.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7898   -1.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8086    2.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5123    3.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5159    5.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2187    5.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9178    5.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9141    3.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2113    2.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9313   -4.3591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 12 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  4 27  1  0
 27 28  3  0
M  END

Associated Targets(non-human)

Slc16a1 Monocarboxylate transporter 1 (151 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.44Molecular Weight (Monoisotopic): 368.1525AlogP: 4.88#Rotatable Bonds: 7
Polar Surface Area: 64.33Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 1.68CX Basic pKa: 3.18CX LogP: 4.60CX LogD: 1.99
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: -0.61

References

1.  (2016)  Therapeutic compounds, 

Source

Source(1):