N-(2-((6-Chloro-3-(4-methoxy-3-(piperidin-1-ylsulfonyl)phenyl)-2-methylimidazo[1,2-b]pyridazin-8-yl)amino)ethyl)acetamide

ID: ALA3978329

PubChem CID: 134152630

Max Phase: Preclinical

Molecular Formula: C23H29ClN6O4S

Molecular Weight: 521.04

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2c(C)nc3c(NCCNC(C)=O)cc(Cl)nn23)cc1S(=O)(=O)N1CCCCC1

Standard InChI:  InChI=1S/C23H29ClN6O4S/c1-15-22(30-23(27-15)18(14-21(24)28-30)26-10-9-25-16(2)31)17-7-8-19(34-3)20(13-17)35(32,33)29-11-5-4-6-12-29/h7-8,13-14,26H,4-6,9-12H2,1-3H3,(H,25,31)

Standard InChI Key:  ZWXGVCIGBYEHOU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    7.9463  -13.7294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7358  -14.5219    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.5273  -14.3079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7274  -12.8152    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.4282  -12.4036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4241  -11.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1290  -11.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1249  -10.3577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4158   -9.9521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7109  -10.3637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9977   -9.9623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9936   -9.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2804   -8.7396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6985   -8.7294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1414  -12.8092    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8464  -12.3976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8381  -11.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6169  -11.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0996  -11.9804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9167  -11.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6220  -12.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8804  -13.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3387  -14.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5971  -14.8056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3972  -14.9683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6556  -15.7430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1139  -16.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9389  -14.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0430  -15.2825    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6846  -13.5817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5354  -15.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8394  -16.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6515  -16.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1588  -16.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8540  -15.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  2  0
 15 16  1  0
 16 17  1  0
  7 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 16 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28  2  1  0
  2 29  1  0
 28 30  2  0
 22 30  1  0
 29 31  1  0
 29 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3978329

    ---

Associated Targets(Human)

PI4KB Tchem PI4-kinase beta subunit (1593 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PI4K2A Tbio PI4-kinase type II (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PI4KA Tchem PI4-kinase alpha subunit (184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.04Molecular Weight (Monoisotopic): 520.1660AlogP: 3.09#Rotatable Bonds: 8
Polar Surface Area: 117.93Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.20CX LogP: 1.42CX LogD: 1.42
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -1.64

References

1. Mejdrová I, Chalupská D, Plačková P, Müller C, Šála M, Klíma M, Baumlová A, Hřebabecký H, Procházková E, Dejmek M, Strunin D, Weber J, Lee G, Matoušová M, Mertlíková-Kaiserová H, Ziebuhr J, Birkus G, Boura E, Nencka R..  (2017)  Rational Design of Novel Highly Potent and Selective Phosphatidylinositol 4-Kinase IIIβ (PI4KB) Inhibitors as Broad-Spectrum Antiviral Agents and Tools for Chemical Biology.,  60  (1): [PMID:28004945] [10.1021/acs.jmedchem.6b01465]

Source