US9328118, 78

ID: ALA3978347

PubChem CID: 117914030

Max Phase: Preclinical

Molecular Formula: C26H28F3N5O2

Molecular Weight: 499.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1nc(-c2ccc(OCCC3CCNCC3)c(C(F)(F)F)c2)c2ccn(C3CCOCC3)c2n1

Standard InChI:  InChI=1S/C26H28F3N5O2/c27-26(28,29)21-15-18(1-2-22(21)36-14-6-17-3-9-31-10-4-17)24-20-5-11-34(19-7-12-35-13-8-19)25(20)33-23(16-30)32-24/h1-2,5,11,15,17,19,31H,3-4,6-10,12-14H2

Standard InChI Key:  HHCFTRLXJXPYIA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    6.5005    0.4438    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4978   -0.7562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5359   -1.3582    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.5383   -0.1583    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969   -1.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8991   -0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5965   -3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943   -3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945   -3.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -3.7597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4870   -5.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7840   -6.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7795   -7.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0747   -8.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0672   -9.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7644  -10.5165    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4691   -9.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4767   -8.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8813   -1.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9619   -2.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4014   -2.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7561   -0.5949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6713    0.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2318    0.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 14  1  0
  7 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 24  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 29  1  0
 22 35  1  0
 35 36  3  0
M  END

Associated Targets(Human)

CTSS Tchem Cathepsin S (3285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.54Molecular Weight (Monoisotopic): 499.2195AlogP: 5.11#Rotatable Bonds: 6
Polar Surface Area: 84.99Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.36CX LogP: 4.35CX LogD: 1.53
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.51Np Likeness Score: -0.80

References

1.  (2016)  Nitrogen-containing bicyclic aromatic heterocyclic compound, 

Source

Source(1):