4-(2-fluorophenyl)-2,2-dimethyl-5-(4-(methylsulfonyl)phenyl)furan-3(2H)-one

ID: ALA3978385

PubChem CID: 9798974

Max Phase: Preclinical

Molecular Formula: C19H17FO4S

Molecular Weight: 360.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)OC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccccc2F)C1=O

Standard InChI:  InChI=1S/C19H17FO4S/c1-19(2)18(21)16(14-6-4-5-7-15(14)20)17(24-19)12-8-10-13(11-9-12)25(3,22)23/h4-11H,1-3H3

Standard InChI Key:  YWJRWWVPYXVDQT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   18.1850  -24.0701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9723  -24.8709    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.7721  -24.6547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7334  -29.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3247  -28.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9113  -29.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6597  -28.3238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9972  -28.3247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7412  -27.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9163  -27.5401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7819  -28.5819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4321  -26.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7691  -26.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2838  -25.4548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4616  -25.5416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1271  -26.3012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6145  -26.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1536  -24.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2220  -26.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0445  -26.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5283  -26.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1910  -25.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3651  -25.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8847  -26.1184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3811  -27.7088    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  7  5  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10  7  1  0
  8 11  2  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 10 12  1  0
 15  2  1  0
  2 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  9 19  1  0
 20 25  1  0
M  END

Associated Targets(non-human)

Ptgs2 Cyclooxygenase-2 (1939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ptgs1 Cyclooxygenase-1 (661 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 360.41Molecular Weight (Monoisotopic): 360.0832AlogP: 3.48#Rotatable Bonds: 3
Polar Surface Area: 60.44Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.18CX LogD: 3.18
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.84Np Likeness Score: -0.36

References

1.  (2002)  4,5-diaryl-3(2H)-furanone derivatives as cyclooxygenase-2 inhibitors, 

Source