The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Benzhydryl-1-(3,3-diphenyl-propionyl)-piperazine-2-carboxylic acid ethyl ester ID: ALA3978555
PubChem CID: 10324784
Max Phase: Preclinical
Molecular Formula: C35H36N2O3
Molecular Weight: 532.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1CN(C(c2ccccc2)c2ccccc2)CCN1C(=O)CC(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C35H36N2O3/c1-2-40-35(39)32-26-36(34(29-19-11-5-12-20-29)30-21-13-6-14-22-30)23-24-37(32)33(38)25-31(27-15-7-3-8-16-27)28-17-9-4-10-18-28/h3-22,31-32,34H,2,23-26H2,1H3
Standard InChI Key: KKZWTCQQRNGVOY-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
12.0701 -10.3332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6615 -11.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8402 -11.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4316 -10.3332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8402 -9.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6615 -9.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0701 -11.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6615 -12.4563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8873 -11.7513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8873 -10.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2959 -11.0422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2959 -9.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1131 -9.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5217 -10.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3388 -10.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7474 -11.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3388 -11.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5217 -11.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1131 -11.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5217 -8.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1131 -8.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5217 -7.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3388 -7.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7474 -8.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3388 -8.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6144 -10.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2058 -11.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6144 -11.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2058 -12.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3886 -12.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9800 -11.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3886 -11.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2058 -9.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3886 -9.6282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9800 -8.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3886 -8.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2058 -8.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6144 -8.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2959 -12.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1131 -12.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
2 7 1 0
10 11 2 0
10 12 1 0
12 13 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
13 14 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
13 20 1 0
1 10 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
26 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
33 38 2 0
4 26 1 0
39 40 1 0
9 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.68Molecular Weight (Monoisotopic): 532.2726AlogP: 6.07#Rotatable Bonds: 9Polar Surface Area: 49.85Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.84CX LogP: 6.67CX LogD: 6.56Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.64
References 1. (2004) Calcium channel inhibitors comprising benzhydril spaced from piperazine,