The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 7-((1R,2S,3R)-3-hydroxy-2-(4-(1-hydroxycyclobutyl)phenyl)-5-oxocyclopentyl)hept-5-enoate ID: ALA3978583
PubChem CID: 11955154
Max Phase: Preclinical
Molecular Formula: C23H30O5
Molecular Weight: 386.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CCC/C=C\C[C@H]1C(=O)C[C@@H](O)[C@@H]1c1ccc(C2(O)CCC2)cc1
Standard InChI: InChI=1S/C23H30O5/c1-28-21(26)8-5-3-2-4-7-18-19(24)15-20(25)22(18)16-9-11-17(12-10-16)23(27)13-6-14-23/h2,4,9-12,18,20,22,25,27H,3,5-8,13-15H2,1H3/b4-2-/t18-,20+,22+/m0/s1
Standard InChI Key: AETUZWCDUUSBRC-NEXMAASUSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
4.8519 -12.7964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1421 -13.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5465 -13.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2564 -13.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1172 -10.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9344 -10.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1888 -9.3722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5258 -8.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8671 -9.3722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5246 -8.0729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6360 -10.8094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4140 -10.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0776 -11.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5565 -12.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2219 -10.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9663 -9.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5729 -9.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3504 -9.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5214 -8.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2990 -8.3664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4700 -7.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2475 -7.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8541 -7.8635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4185 -6.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7028 -11.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3722 -12.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1961 -6.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6656 -12.7086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
5 11 1 6
6 12 1 1
12 13 2 0
13 14 1 0
14 26 2 0
25 15 2 0
15 12 1 0
7 16 1 6
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
25 26 1 0
24 27 1 0
26 1 1 0
1 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 386.49Molecular Weight (Monoisotopic): 386.2093AlogP: 3.38#Rotatable Bonds: 8Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.05CX LogD: 3.05Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.41Np Likeness Score: 1.46
References 1. (2010) Therapeutic compounds,