1-(benzo[d][1,3]dioxol-5-ylmethyl)-N-benzyl-1,4-dihydroquinazolin-2-amine

ID: ALA3978715

PubChem CID: 134151527

Max Phase: Preclinical

Molecular Formula: C23H21N3O2

Molecular Weight: 371.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc(CNC2=NCc3ccccc3N2Cc2ccc3c(c2)OCO3)cc1

Standard InChI:  InChI=1S/C23H21N3O2/c1-2-6-17(7-3-1)13-24-23-25-14-19-8-4-5-9-20(19)26(23)15-18-10-11-21-22(12-18)28-16-27-21/h1-12H,13-16H2,(H,24,25)

Standard InChI Key:  CWDWGKJQNBEROO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   13.5141   -7.9384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2274   -7.5288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2308   -6.7038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5166   -6.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8032   -6.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0891   -6.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3716   -6.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3682   -7.5213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0823   -7.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7999   -7.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5107   -8.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9416   -7.9442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6550   -7.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3691   -7.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3699   -8.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0799   -9.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7975   -8.7766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8008   -7.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0867   -7.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7946   -9.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0837   -8.7566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0821  -10.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7948   -9.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3643   -9.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3647   -9.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5810   -8.9124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0964   -9.5789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5805  -10.2456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  1 10  1  0
  5 10  2  0
  1 11  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
 12 13  1  0
  2 12  1  0
 11 20  1  0
 20 21  2  0
 21 25  1  0
 24 22  1  0
 22 23  2  0
 23 20  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3978715

    ---

Associated Targets(Human)

ADRA2A Tclin Adrenergic receptor alpha-2 (812 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.44Molecular Weight (Monoisotopic): 371.1634AlogP: 4.08#Rotatable Bonds: 4
Polar Surface Area: 46.09Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.61CX LogP: 4.44CX LogD: 2.44
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.75Np Likeness Score: -0.69

References

1. McMullan M, García-Bea A, Miranda-Azpiazu P, Callado LF, Rozas I..  (2016)  Substituted conformationally restricted guanidine derivatives: Probing the α2-adrenoceptors' binding pocket.,  123  [PMID:27474922] [10.1016/j.ejmech.2016.07.011]

Source