The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3R)1-[4-(2-fluoro-4-chlorobenzyloxy)-benzenesulfonyl]-3-hydroxy-3-methyl-piperidine-2-carboxylicacid hydroxyamide ID: ALA3979213
PubChem CID: 134151538
Max Phase: Preclinical
Molecular Formula: C21H25ClN2O6S
Molecular Weight: 468.96
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Cl)ccc1COc1ccc(S(=O)(=O)N2CCC[C@@](C)(O)[C@@H]2C(=O)NO)cc1
Standard InChI: InChI=1S/C21H25ClN2O6S/c1-14-12-16(22)5-4-15(14)13-30-17-6-8-18(9-7-17)31(28,29)24-11-3-10-21(2,26)19(24)20(25)23-27/h4-9,12,19,26-27H,3,10-11,13H2,1-2H3,(H,23,25)/t19-,21+/m0/s1
Standard InChI Key: YZTJOVZZAVKUOK-PZJWPPBQSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
7.0411 -5.1136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7509 -5.5222 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7498 -4.7032 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3682 -6.2430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5515 -6.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1675 -6.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6001 -7.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4168 -7.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8009 -6.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1189 -5.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5029 -4.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3022 -5.6058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8695 -4.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5599 -7.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5238 -6.4889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5693 -5.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9779 -4.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7951 -4.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2037 -5.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7951 -6.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9779 -6.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0209 -5.5232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4295 -6.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2466 -6.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6552 -5.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4724 -5.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8810 -6.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4724 -6.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6552 -6.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6982 -6.2309 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.2466 -4.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
4 9 1 0
10 11 2 0
12 13 1 0
10 12 1 0
5 10 1 6
6 14 1 0
6 15 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
2 16 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
22 23 1 0
27 30 1 0
25 31 1 0
19 22 1 0
4 2 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.96Molecular Weight (Monoisotopic): 468.1122AlogP: 2.64#Rotatable Bonds: 6Polar Surface Area: 116.17Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.68CX Basic pKa: ┄CX LogP: 2.65CX LogD: 2.62Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -0.91
References 1. (2001) Selective inhibitors of aggrecanase in osteoarthritis treatment,