The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9328118, 52 ID: ALA3979251
PubChem CID: 117914049
Max Phase: Preclinical
Molecular Formula: C27H31F3N6O2
Molecular Weight: 528.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCC(CCOc2ncc(-c3nc(C#N)nc4c3ccn4CC3CCOC3)cc2C(F)(F)F)CC1
Standard InChI: InChI=1S/C27H31F3N6O2/c1-2-35-8-3-18(4-9-35)7-12-38-26-22(27(28,29)30)13-20(15-32-26)24-21-5-10-36(16-19-6-11-37-17-19)25(21)34-23(14-31)33-24/h5,10,13,15,18-19H,2-4,6-9,11-12,16-17H2,1H3
Standard InChI Key: XBZQPYJROWDGHL-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
14.2827 0.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2866 -0.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9898 -1.4988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9926 -2.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6950 -3.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3945 -3.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0946 -3.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7945 -3.0041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 -3.7543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8919 -5.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8521 -5.8523 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.9304 -5.8546 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8906 -6.4533 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8794 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8823 -2.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3600 -2.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9656 -3.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8476 -4.7650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5510 -4.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 4.2008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3918 -1.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6894 -0.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
13 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
22 35 1 0
35 36 3 0
6 37 1 0
37 38 1 0
38 3 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.58Molecular Weight (Monoisotopic): 528.2461AlogP: 4.92#Rotatable Bonds: 8Polar Surface Area: 89.09Molecular Species: BASEHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.52CX LogP: 4.55CX LogD: 2.44Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.41Np Likeness Score: -1.14
References 1. (2016) Nitrogen-containing bicyclic aromatic heterocyclic compound,