The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl (amino(4-((8-(1-(pyrrolidine-1-carbonyl)cyclopentyl)-1,2,3,4-tetrahydrobenzo[4,5]imidazo[1,2-a]pyrazin-1-yl)methyl)phenyl)methylene)carbamate ID: ALA3979276
Max Phase: Preclinical
Molecular Formula: C31H38N6O3
Molecular Weight: 542.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)/N=C(\N)c1ccc(CC2NCCn3c2nc2cc(C4(C(=O)N5CCCC5)CCCC4)ccc23)cc1
Standard InChI: InChI=1S/C31H38N6O3/c1-2-40-30(39)35-27(32)22-9-7-21(8-10-22)19-25-28-34-24-20-23(11-12-26(24)37(28)18-15-33-25)31(13-3-4-14-31)29(38)36-16-5-6-17-36/h7-12,20,25,33H,2-6,13-19H2,1H3,(H2,32,35,39)
Standard InChI Key: ATMALHVUQAHUDQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
16.7858 -10.4992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9620 -10.5423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2351 -11.1911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1604 -9.7642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5874 -11.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7624 -11.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3500 -11.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5250 -11.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1124 -11.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5250 -10.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3500 -10.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2874 -11.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0500 -10.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8750 -10.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6375 -9.8485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2874 -9.8485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8750 -9.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0500 -9.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4979 -11.1761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7443 -10.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8305 -10.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1631 -9.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4094 -9.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3232 -10.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9906 -11.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5696 -11.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7625 -11.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6763 -12.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4300 -12.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9820 -11.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3146 -10.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8338 -9.6010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4997 -10.1130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9164 -10.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1814 -10.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3104 -9.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1253 -9.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9999 -11.9920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9843 -9.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3587 -8.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
13 14 1 0
13 15 1 0
14 16 1 0
16 17 1 0
17 18 1 0
15 18 1 0
19 20 1 0
20 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
21 22 2 0
15 21 1 0
13 19 2 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
26 30 1 0
31 32 2 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
33 37 1 0
31 33 1 0
26 31 1 0
24 26 1 0
12 14 1 0
9 12 1 0
5 6 1 0
5 38 1 0
2 5 2 0
39 40 1 0
4 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.68Molecular Weight (Monoisotopic): 542.3005AlogP: 4.22#Rotatable Bonds: 6Polar Surface Area: 114.84Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.55CX LogP: 3.81CX LogD: 3.43Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.36Np Likeness Score: -0.70
References 1. Chen D, Shi J, Liu J, Zhang X, Deng X, Yang Y, Cui S, Zhu Q, Gong G, Xu Y.. (2017) Design, synthesis and antithrombotic evaluation of novel non-peptide thrombin inhibitors., 25 (2): [PMID:27884512 ] [10.1016/j.bmc.2016.11.012 ]