US9145380, 76

ID: ALA3979332

PubChem CID: 42643900

Max Phase: Preclinical

Molecular Formula: C14H15ClN2O4S2

Molecular Weight: 374.87

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccccc1NS(=O)(=O)CCc1ccccc1Cl

Standard InChI:  InChI=1S/C14H15ClN2O4S2/c15-12-6-2-1-5-11(12)9-10-22(18,19)17-13-7-3-4-8-14(13)23(16,20)21/h1-8,17H,9-10H2,(H2,16,20,21)

Standard InChI Key:  VXXQJLMUZWBWNG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    2.5984   -2.7004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6384   -0.9011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6377   -2.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421   -3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3020   -2.5494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6078   -5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6109   -7.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3118   -8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3119   -9.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6109  -10.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9100   -9.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9099   -8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9492   -7.6497    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  2  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  2  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
M  END

Associated Targets(Human)

PTGES2 Tchem Prostaglandin E synthase 2 (329 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 374.87Molecular Weight (Monoisotopic): 374.0162AlogP: 1.97#Rotatable Bonds: 6
Polar Surface Area: 106.33Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.72CX Basic pKa: CX LogP: 1.72CX LogD: 1.15
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.81Np Likeness Score: -1.77

References

1.  (2015)  Bis-(sulfonylamino) derivatives for use in therapy, 

Source

Source(1):