The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-(4-isopropoxyphenylsulfonyl)piperazin-1-yl)-2-methylphenoxy)acetic acid ID: ALA3979423
PubChem CID: 118134853
Max Phase: Preclinical
Molecular Formula: C22H28N2O6S
Molecular Weight: 448.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(N2CCN(S(=O)(=O)c3ccc(OC(C)C)cc3)CC2)cc1OCC(=O)O
Standard InChI: InChI=1S/C22H28N2O6S/c1-16(2)30-19-6-8-20(9-7-19)31(27,28)24-12-10-23(11-13-24)18-5-4-17(3)21(14-18)29-15-22(25)26/h4-9,14,16H,10-13,15H2,1-3H3,(H,25,26)
Standard InChI Key: SVNTXKVMYAHYTA-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
31.2349 -14.1894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2390 -15.0066 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.9446 -14.5944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1921 -14.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7945 -15.0448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2139 -15.7413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0269 -15.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4245 -15.0171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0091 -14.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9780 -15.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5581 -14.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7418 -14.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3444 -15.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7694 -15.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5843 -15.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6590 -15.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2575 -16.4223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6743 -17.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4923 -17.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8917 -16.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4726 -15.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9107 -17.8165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7278 -17.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1462 -18.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1265 -17.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3754 -16.5047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5583 -16.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1643 -17.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3473 -17.2541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5873 -17.9366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5274 -15.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
5 10 1 0
8 2 1 0
2 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
14 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
13 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.54Molecular Weight (Monoisotopic): 448.1668AlogP: 2.76#Rotatable Bonds: 8Polar Surface Area: 96.38Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.05CX Basic pKa: 1.96CX LogP: 3.21CX LogD: 0.08Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.71
References 1. (2012) Sulfonamide derivative having PGD2 receptor antagonistic activity,