US9145380, 168

ID: ALA3979763

PubChem CID: 57751065

Max Phase: Preclinical

Molecular Formula: C17H14ClN3O4S2

Molecular Weight: 423.90

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccccc1NS(=O)(=O)c1cccc(-c2cncc(Cl)c2)c1

Standard InChI:  InChI=1S/C17H14ClN3O4S2/c18-14-8-13(10-20-11-14)12-4-3-5-15(9-12)27(24,25)21-16-6-1-2-7-17(16)26(19,22)23/h1-11,21H,(H2,19,22,23)

Standard InChI Key:  GSQKPIUDORXKER-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    2.5984   -2.7004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6384   -0.9011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6377   -2.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421   -3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3020   -2.5494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0095   -6.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0126   -7.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3132   -8.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6106   -7.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6076   -5.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9119   -8.2452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9174   -9.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2192  -10.4906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5155   -9.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5100   -8.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5471   -7.6321    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.2083   -7.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  2  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  2  0
 12 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 27 21  1  0
M  END

Associated Targets(Human)

PTGES2 Tchem Prostaglandin E synthase 2 (329 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.90Molecular Weight (Monoisotopic): 423.0114AlogP: 2.85#Rotatable Bonds: 5
Polar Surface Area: 119.22Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.70CX Basic pKa: 2.90CX LogP: 2.10CX LogD: 1.51
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.65Np Likeness Score: -1.88

References

1.  (2015)  Bis-(sulfonylamino) derivatives for use in therapy, 

Source

Source(1):