US9394289, 8

ID: ALA3979814

PubChem CID: 24874602

Max Phase: Preclinical

Molecular Formula: C29H38N6O2

Molecular Weight: 502.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(C2(c3ccc(NC(=O)c4ncc(C#N)[nH]4)c(C4=CCC(C)(C)CC4)c3)CCOCC2)CC1

Standard InChI:  InChI=1S/C29H38N6O2/c1-28(2)8-6-21(7-9-28)24-18-22(4-5-25(24)33-27(36)26-31-20-23(19-30)32-26)29(10-16-37-17-11-29)35-14-12-34(3)13-15-35/h4-6,18,20H,7-17H2,1-3H3,(H,31,32)(H,33,36)

Standard InChI Key:  VKVMJFMNNAMTJR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5989    1.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8987    2.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9004    3.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6022    4.4587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3023    3.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3006    2.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8974    0.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8943   -0.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1918   -1.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4924   -0.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7890   -1.5143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7837   -3.0151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7422   -3.6111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0803   -3.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2151   -5.2520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6817   -5.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4344   -4.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9248   -4.1160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.1184   -3.9931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4330   -3.1527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4955    0.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1980    1.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7967    1.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0955    0.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3949    1.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3957    2.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4201    2.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3681    4.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0970    3.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7976    2.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
  8 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  3  0
 24 27  1  0
 27 21  1  0
 17 28  1  0
 28 29  2  0
 29 14  1  0
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
 36 37  1  0
 37 30  1  0
M  END

Associated Targets(non-human)

Csf1r Macrophage colony-stimulating factor 1 receptor (491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.66Molecular Weight (Monoisotopic): 502.3056AlogP: 4.38#Rotatable Bonds: 5
Polar Surface Area: 97.28Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.79CX Basic pKa: 8.23CX LogP: 1.20CX LogD: 1.48
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.63Np Likeness Score: -0.29

References

1.  (2016)  Inhibitors of c-fms kinase, 

Source

Source(1):