(S)-4-((S)-2-carbamoylpyrrolidin-1-yl)-4-oxo-3-((S)-5-oxopyrrolidine-2-carboxamido)butanoic acid

ID: ALA3979818

PubChem CID: 134152760

Max Phase: Preclinical

Molecular Formula: C14H20N4O6

Molecular Weight: 340.34

Molecule Type: Protein

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCC(=O)N1

Standard InChI:  InChI=1S/C14H20N4O6/c15-12(22)9-2-1-5-18(9)14(24)8(6-11(20)21)17-13(23)7-3-4-10(19)16-7/h7-9H,1-6H2,(H2,15,22)(H,16,19)(H,17,23)(H,20,21)/t7-,8-,9-/m0/s1

Standard InChI Key:  VCXJBPVMIZJBFN-CIUDSAMLSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   20.0982  -18.0061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6434  -16.7269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3568  -16.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0702  -16.7269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7836  -16.3126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0702  -17.5513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6434  -17.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9258  -17.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3568  -17.9615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1734  -17.6338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6232  -18.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0375  -18.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8438  -18.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8033  -18.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5364  -16.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0867  -16.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8261  -15.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7109  -17.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4955  -17.7043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5787  -15.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3568  -15.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6392  -15.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6392  -14.2411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9216  -15.4839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  2  7  1  0
  8  7  1  6
  7  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
 11 14  2  0
  5 15  1  0
 15 16  1  0
 17  5  1  0
 15 18  1  1
 18 19  2  0
 17 20  1  0
 20 16  1  0
 18  1  1  0
  3 21  1  1
 21 22  1  0
 22 23  2  0
 22 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3979818

    ---

Associated Targets(non-human)

TRHDE Thyrotropin releasing hormone degrading enzyme (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 340.34Molecular Weight (Monoisotopic): 340.1383AlogP: -2.30#Rotatable Bonds: 6
Polar Surface Area: 158.90Molecular Species: ACIDHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 4.09CX Basic pKa: CX LogP: -3.14CX LogD: -6.24
Aromatic Rings: Heavy Atoms: 24QED Weighted: 0.43Np Likeness Score: -0.20

References

1.  (2010)  TRH-like peptide derivatives as inhibitors of the TRH-degrading ectoenzyme, 

Source