US9150577, 230

ID: ALA3980088

PubChem CID: 68323514

Max Phase: Preclinical

Molecular Formula: C24H27N5O3

Molecular Weight: 433.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCNC(=O)c1ccccc1NC(=O)c1ccc2cc3n(c2c1)CCCNC3=O

Standard InChI:  InChI=1S/C24H27N5O3/c1-28(2)13-11-26-23(31)18-6-3-4-7-19(18)27-22(30)17-9-8-16-14-21-24(32)25-10-5-12-29(21)20(16)15-17/h3-4,6-9,14-15H,5,10-13H2,1-2H3,(H,25,32)(H,26,31)(H,27,30)

Standard InChI Key:  DJIFBHGZEXFYSR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -8.6495   -6.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4932   -6.6621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1934   -5.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4219   -7.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9757   -7.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9044   -8.3629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4582   -7.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1584   -6.7996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3869   -9.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7643  -10.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6958  -11.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7502  -11.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1276   -9.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0590   -8.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4396   -7.1617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8869   -6.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7403   -7.6082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2675   -5.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7135   -4.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0908   -3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0226   -2.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0899   -0.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2896    1.8259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5767   -2.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1989   -4.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 23  1  0
 30 31  1  0
 31 21  1  0
 31 32  2  0
 32 18  1  0
M  END

Associated Targets(Human)

RPS6KA2 Tchem Ribosomal protein S6 kinase alpha 2 (2184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 433.51Molecular Weight (Monoisotopic): 433.2114AlogP: 2.32#Rotatable Bonds: 6
Polar Surface Area: 95.47Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.51CX LogP: 2.01CX LogD: 0.87
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: -1.20

References

1.  (2015)  Heterocyclic compounds containing an indole core, 

Source

Source(1):