The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9145380, 156 ID: ALA3980128
PubChem CID: 57751114
Max Phase: Preclinical
Molecular Formula: C19H15F3N2O6S2
Molecular Weight: 488.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)c1cc(Oc2ccccc2)ccc1NS(=O)(=O)c1cccc(OC(F)(F)F)c1
Standard InChI: InChI=1S/C19H15F3N2O6S2/c20-19(21,22)30-15-7-4-8-16(11-15)32(27,28)24-17-10-9-14(12-18(17)31(23,25)26)29-13-5-2-1-3-6-13/h1-12,24H,(H2,23,25,26)
Standard InChI Key: IADYMWITVIJYEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
2.5984 -2.7004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6384 -0.9011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6377 -2.1009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9073 5.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9021 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6005 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 -3.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3020 -2.5494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0095 -6.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0126 -7.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3132 -8.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6106 -7.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9135 -8.2426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2106 -7.4877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2523 -8.0834 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.2061 -6.2877 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.2475 -6.8836 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6076 -5.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
7 15 2 0
15 16 1 0
16 17 2 0
17 5 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 2 0
19 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
26 32 2 0
32 22 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.47Molecular Weight (Monoisotopic): 488.0324AlogP: 3.83#Rotatable Bonds: 7Polar Surface Area: 124.79Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.70CX Basic pKa: ┄CX LogP: 4.00CX LogD: 3.41Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -1.55
References 1. (2015) Bis-(sulfonylamino) derivatives for use in therapy,