US9145380, 156

ID: ALA3980128

PubChem CID: 57751114

Max Phase: Preclinical

Molecular Formula: C19H15F3N2O6S2

Molecular Weight: 488.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1cc(Oc2ccccc2)ccc1NS(=O)(=O)c1cccc(OC(F)(F)F)c1

Standard InChI:  InChI=1S/C19H15F3N2O6S2/c20-19(21,22)30-15-7-4-8-16(11-15)32(27,28)24-17-10-9-14(12-18(17)31(23,25)26)29-13-5-2-1-3-6-13/h1-12,24H,(H2,23,25,26)

Standard InChI Key:  IADYMWITVIJYEU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    2.5984   -2.7004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6384   -0.9011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6377   -2.1009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3092    5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6108    5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9073    5.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9021    3.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6005    2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421   -3.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3020   -2.5494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0095   -6.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0126   -7.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3132   -8.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6106   -7.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9135   -8.2426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2106   -7.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2523   -8.0834    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2061   -6.2877    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2475   -6.8836    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6076   -5.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  2  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  7 15  2  0
 15 16  1  0
 16 17  2  0
 17  5  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  2  0
 19 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
 26 32  2  0
 32 22  1  0
M  END

Associated Targets(Human)

PTGES2 Tchem Prostaglandin E synthase 2 (329 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.47Molecular Weight (Monoisotopic): 488.0324AlogP: 3.83#Rotatable Bonds: 7
Polar Surface Area: 124.79Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.70CX Basic pKa: CX LogP: 4.00CX LogD: 3.41
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -1.55

References

1.  (2015)  Bis-(sulfonylamino) derivatives for use in therapy, 

Source

Source(1):