US9150577, 145

ID: ALA3980455

PubChem CID: 68323583

Max Phase: Preclinical

Molecular Formula: C22H23N3O2

Molecular Weight: 361.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)c1cccc(NC(=O)c2ccc3cc4n(c3c2)CCCNC4=O)c1

Standard InChI:  InChI=1S/C22H23N3O2/c1-14(2)15-5-3-6-18(11-15)24-21(26)17-8-7-16-12-20-22(27)23-9-4-10-25(20)19(16)13-17/h3,5-8,11-14H,4,9-10H2,1-2H3,(H,23,27)(H,24,26)

Standard InChI Key:  DUCUIRXEVXZKPK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    2.9778  -11.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8215  -12.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5215  -13.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7502  -11.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6958  -11.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7643  -10.4643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3869   -9.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0590   -8.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4396   -7.1617    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8869   -6.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7403   -7.6082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2675   -5.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7135   -4.9137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0908   -3.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0226   -2.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0899   -0.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2896    1.8259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5767   -2.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1989   -4.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1276   -9.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 17  1  0
 24 25  1  0
 25 15  1  0
 25 26  2  0
 26 12  1  0
  8 27  2  0
 27  4  1  0
M  END

Associated Targets(Human)

RPS6KA2 Tchem Ribosomal protein S6 kinase alpha 2 (2184 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 361.45Molecular Weight (Monoisotopic): 361.1790AlogP: 4.15#Rotatable Bonds: 3
Polar Surface Area: 63.13Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.52CX LogD: 3.52
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.74Np Likeness Score: -0.92

References

1.  (2015)  Heterocyclic compounds containing an indole core, 

Source

Source(1):