US9428478, TG2-150

ID: ALA3980488

PubChem CID: 18096451

Max Phase: Preclinical

Molecular Formula: C21H25N3O3

Molecular Weight: 367.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(N2CCN(C(=O)CNc3ccc(C(C)=O)cc3)CC2)cc1

Standard InChI:  InChI=1S/C21H25N3O3/c1-16(25)17-3-5-18(6-4-17)22-15-21(26)24-13-11-23(12-14-24)19-7-9-20(27-2)10-8-19/h3-10,22H,11-15H2,1-2H3

Standard InChI Key:  PDUZMCJPSVQAHF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6012    3.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9015    3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1993    2.9963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1969    1.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8967    0.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5018    3.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5058    4.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7993    2.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1017    3.7333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3992    2.9790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7021    3.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9973    2.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9898    1.4658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6870    0.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3917    1.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2842    0.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2764   -0.4938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -15.3274    1.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  6  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14  9  1  0
 12 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
M  END

Associated Targets(Human)

CYBB Tchem Cytochrome b-245 heavy chain (193 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XDH Tclin Xanthine dehydrogenase (1038 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 367.45Molecular Weight (Monoisotopic): 367.1896AlogP: 2.66#Rotatable Bonds: 6
Polar Surface Area: 61.88Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.99CX LogP: 1.70CX LogD: 1.70
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.80Np Likeness Score: -1.46

References

1.  (2016)  Piperazine derivatives, compositions, and uses related thereto, 

Source

Source(1):