The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9346786, 56 ID: ALA3980572
PubChem CID: 53246744
Max Phase: Preclinical
Molecular Formula: C25H28ClF2N3O3
Molecular Weight: 491.97
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(C(=O)Oc1ccc(F)cc1)[C@@H]1CN(C(=O)C2CCNCC2)C[C@H]1c1ccc(Cl)c(F)c1
Standard InChI: InChI=1S/C25H28ClF2N3O3/c1-2-31(25(33)34-19-6-4-18(27)5-7-19)23-15-30(24(32)16-9-11-29-12-10-16)14-20(23)17-3-8-21(26)22(28)13-17/h3-8,13,16,20,23,29H,2,9-12,14-15H2,1H3/t20-,23+/m0/s1
Standard InChI Key: YYOPTZCYJYCYFR-NZQKXSOJSA-N
Molfile:
RDKit 2D
34 37 0 0 1 0 0 0 0 0999 V2000
3.3851 2.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1391 1.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2567 0.5852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8054 -4.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9984 -4.7960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9195 -5.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5226 -7.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6348 -8.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1438 -8.2963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5407 -6.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4285 -5.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6819 1.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5772 0.2566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9880 2.5249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4132 2.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7213 4.4634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1466 4.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2640 3.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4043 4.3038 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.9560 2.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5307 1.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 1 6
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
8 9 1 1
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
16 9 1 0
6 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 19 1 0
3 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
31 33 1 0
33 34 2 0
34 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.97Molecular Weight (Monoisotopic): 491.1787AlogP: 4.43#Rotatable Bonds: 5Polar Surface Area: 61.88Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.17CX LogP: 3.85CX LogD: 1.21Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.67Np Likeness Score: -1.27
References 1. (2016) Pyrrolidine compounds,