US9346786, 81

ID: ALA3980824

PubChem CID: 53247484

Max Phase: Preclinical

Molecular Formula: C26H30ClF2N3O5S

Molecular Weight: 570.06

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(C(=O)Oc1ccc(F)cc1)[C@@H]1CN(C(=O)C2CCN(S(C)(=O)=O)CC2)C[C@H]1c1ccc(Cl)c(F)c1

Standard InChI:  InChI=1S/C26H30ClF2N3O5S/c1-3-32(26(34)37-20-7-5-19(28)6-8-20)24-16-30(15-21(24)18-4-9-22(27)23(29)14-18)25(33)17-10-12-31(13-11-17)38(2,35)36/h4-9,14,17,21,24H,3,10-13,15-16H2,1-2H3/t21-,24+/m0/s1

Standard InChI Key:  WYAWFWHOVHCJQS-XUZZJYLKSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  1  0  0  0  0  0999 V2000
    3.3851    2.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1391    1.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2567    0.5852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511   -0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8054   -4.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9984   -4.7960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9195   -5.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5226   -7.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6348   -8.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1438   -8.2963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5407   -6.9229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4285   -5.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2555   -9.5060    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7374  -10.6050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0628   -9.3741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5448  -10.4729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6819    1.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5772    0.2566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9880    2.5249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4132    2.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7213    4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1466    4.9307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2640    3.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4043    4.3038    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.9560    2.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5307    1.9947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  6
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  8  9  1  1
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 16  9  1  0
  6 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 19  1  0
 22 25  1  0
 25 26  2  0
 25 27  2  0
 25 28  1  0
  3 29  1  0
 29 30  2  0
 29 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  2  0
 38 32  1  0
M  END

Associated Targets(Human)

TACR3 Tchem Neurokinin 3 receptor (1696 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 570.06Molecular Weight (Monoisotopic): 569.1563AlogP: 4.11#Rotatable Bonds: 6
Polar Surface Area: 87.23Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 2.96CX LogD: 2.96
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.52Np Likeness Score: -1.66

References

1.  (2016)  Pyrrolidine compounds, 

Source

Source(1):