The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9475795, 65 ID: ALA3981069
PubChem CID: 72550667
Max Phase: Preclinical
Molecular Formula: C18H20Cl2N4O2S
Molecular Weight: 427.36
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1n[nH]c(C)c1S(=O)(=O)N1CCC(C#N)(Cc2ccc(Cl)cc2Cl)CC1
Standard InChI: InChI=1S/C18H20Cl2N4O2S/c1-12-17(13(2)23-22-12)27(25,26)24-7-5-18(11-21,6-8-24)10-14-3-4-15(19)9-16(14)20/h3-4,9H,5-8,10H2,1-2H3,(H,22,23)
Standard InChI Key: CQPUJVNWYRAUIJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
3.1417 1.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0377 0.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5052 1.0408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2543 -0.2587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2499 -1.3728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4917 -2.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5984 -2.7004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6377 -2.1009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2626 2.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0368 2.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3215 2.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6342 2.9314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6621 4.4312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7124 5.0117 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.3773 5.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0645 4.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9634 5.0987 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5629 -0.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5871 -0.6469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 2 0
7 2 1 0
7 8 1 0
8 9 2 0
8 10 2 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
19 21 1 0
21 22 2 0
22 16 1 0
22 23 1 0
14 24 1 0
24 25 1 0
25 11 1 0
14 26 1 0
26 27 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.36Molecular Weight (Monoisotopic): 426.0684AlogP: 3.87#Rotatable Bonds: 4Polar Surface Area: 89.85Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.99CX Basic pKa: 2.62CX LogP: 3.14CX LogD: 3.14Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.80Np Likeness Score: -1.71
References 1. (2016) Sulfonyl piperidine derivatives and their use for treating prokineticin mediated diseases,