US9133148, 9y

ID: ALA3981094

PubChem CID: 71657291

Max Phase: Preclinical

Molecular Formula: C19H23F6N3O3

Molecular Weight: 455.40

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(OC(C(F)(F)F)C(F)(F)F)N1CCN(Cc2ccccc2N2CCOCC2)CC1

Standard InChI:  InChI=1S/C19H23F6N3O3/c20-18(21,22)16(19(23,24)25)31-17(29)28-7-5-26(6-8-28)13-14-3-1-2-4-15(14)27-9-11-30-12-10-27/h1-4,16H,5-13H2

Standard InChI Key:  QEFPMPXVTAMMDV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    4.9292   -5.8600    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8509   -5.8560    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8889   -6.4578    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2060    2.9916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9107    3.7483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9183    5.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2211    5.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5164    5.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5088    3.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1929   -3.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1932   -1.8062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.2322   -2.4063    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.2321   -3.6062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 20  1  0
 12 26  1  0
 26 27  1  0
 27  9  1  0
  5 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
M  END

Associated Targets(non-human)

Faah Anandamide amidohydrolase (476 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 455.40Molecular Weight (Monoisotopic): 455.1644AlogP: 3.27#Rotatable Bonds: 4
Polar Surface Area: 45.25Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.63CX LogP: 3.47CX LogD: 3.40
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: -1.24

References

1.  (2015)  Carbamate compounds and of making and using same, 

Source

Source(1):