US9394289, 34

ID: ALA3981521

PubChem CID: 71157223

Max Phase: Preclinical

Molecular Formula: C23H26N4O4S

Molecular Weight: 454.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)C1(c2ccc(NC(=O)c3ncc(C#N)[nH]3)c(C3=CCCCC3)c2)CCOCC1

Standard InChI:  InChI=1S/C23H26N4O4S/c1-32(29,30)23(9-11-31-12-10-23)17-7-8-20(19(13-17)16-5-3-2-4-6-16)27-22(28)21-25-15-18(14-24)26-21/h5,7-8,13,15H,2-4,6,9-12H2,1H3,(H,25,26)(H,27,28)

Standard InChI Key:  PWXLKXFMJCTNML-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    2.3019   -2.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2626   -2.2300    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.2236   -2.8304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2629   -3.4300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5629    0.0216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8799   -0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1602    0.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1235    1.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4060    2.3642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7228    1.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7501    0.4443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0053    2.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3715    1.8357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3476    2.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5660    4.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1417    5.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6028    6.7461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1069    3.9072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8064    2.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5262    1.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7696    3.8031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0487    4.5868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0095    6.0863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6914    6.8022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4123    6.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4515    4.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
  5 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  3  0
 21 24  1  0
 24 18  1  0
 14 25  1  0
 25 26  2  0
 26 11  1  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 27  1  0
M  END

Associated Targets(non-human)

Csf1r Macrophage colony-stimulating factor 1 receptor (491 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.55Molecular Weight (Monoisotopic): 454.1675AlogP: 3.54#Rotatable Bonds: 5
Polar Surface Area: 124.94Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 5.80CX Basic pKa: 0.62CX LogP: 1.74CX LogD: 0.90
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.71Np Likeness Score: -0.61

References

1.  (2016)  Inhibitors of c-fms kinase, 

Source

Source(1):