The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394289, 34 ID: ALA3981521
PubChem CID: 71157223
Max Phase: Preclinical
Molecular Formula: C23H26N4O4S
Molecular Weight: 454.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)C1(c2ccc(NC(=O)c3ncc(C#N)[nH]3)c(C3=CCCCC3)c2)CCOCC1
Standard InChI: InChI=1S/C23H26N4O4S/c1-32(29,30)23(9-11-31-12-10-23)17-7-8-20(19(13-17)16-5-3-2-4-6-16)27-22(28)21-25-15-18(14-24)26-21/h5,7-8,13,15H,2-4,6,9-12H2,1H3,(H,25,26)(H,27,28)
Standard InChI Key: PWXLKXFMJCTNML-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
2.3019 -2.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2626 -2.2300 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.2236 -2.8304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2629 -3.4300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5629 0.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8799 -0.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1602 0.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1235 1.5848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4060 2.3642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7228 1.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7501 0.4443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0053 2.4234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3715 1.8357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3476 2.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5660 4.2550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1417 5.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6028 6.7461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1069 3.9072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8064 2.3028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5262 1.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7696 3.8031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0487 4.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0095 6.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6914 6.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4123 6.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4515 4.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
5 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 3 0
21 24 1 0
24 18 1 0
14 25 1 0
25 26 2 0
26 11 1 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.55Molecular Weight (Monoisotopic): 454.1675AlogP: 3.54#Rotatable Bonds: 5Polar Surface Area: 124.94Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.80CX Basic pKa: 0.62CX LogP: 1.74CX LogD: 0.90Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.71Np Likeness Score: -0.61
References 1. (2016) Inhibitors of c-fms kinase,