The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-endo-(8-{2-[(4-fluorobenzyl)-(2-methanesulfonylacetyl)amino]ethyl}-8-azabicyclo[3.2.1]oct-3-yl)-benzamide trifluoroacetate salt ID: ALA3981656
PubChem CID: 134157148
Max Phase: Preclinical
Molecular Formula: C28H33F4N3O6S
Molecular Weight: 501.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)CC(=O)N(CCN1[C@@H]2CC[C@H]1C[C@@H](c1cccc(C(N)=O)c1)C2)Cc1ccc(F)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C26H32FN3O4S.C2HF3O2/c1-35(33,34)17-25(31)29(16-18-5-7-22(27)8-6-18)11-12-30-23-9-10-24(30)15-21(14-23)19-3-2-4-20(13-19)26(28)32;3-2(4,5)1(6)7/h2-8,13,21,23-24H,9-12,14-17H2,1H3,(H2,28,32);(H,6,7)/t21-,23+,24-;
Standard InChI Key: SRLDYHPGRXASEQ-LLWNGYSHSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
12.0251 -8.5817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3233 -8.1754 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.3223 -8.9863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1626 -5.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7528 -6.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9279 -6.7175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5181 -7.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9332 -8.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7621 -8.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1720 -7.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9917 -5.9907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7477 -5.2814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4542 -8.1603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2832 -8.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6931 -7.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2740 -6.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4490 -6.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0197 -7.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0242 -7.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0391 -7.4455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2143 -7.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7951 -6.7361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9702 -6.7374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5603 -7.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9754 -8.1681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7354 -7.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5551 -6.0227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7261 -6.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3110 -5.3133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4862 -5.3187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0763 -6.0346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4913 -6.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3163 -6.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2472 -6.0401 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.5129 -8.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7693 -8.6611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0573 -9.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3536 -8.6467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0490 -9.8769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3370 -10.2801 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7527 -10.2945 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0376 -10.6912 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
4 11 2 0
4 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 1
18 19 1 0
13 19 1 1
13 20 1 0
17 20 1 0
21 22 1 0
24 25 2 0
24 26 1 0
26 2 1 0
23 24 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 2 0
31 34 1 0
23 27 1 0
22 23 1 0
20 21 1 0
15 7 1 1
2 35 1 0
36 37 1 0
37 38 2 0
37 39 1 0
39 40 1 0
39 41 1 0
39 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.62Molecular Weight (Monoisotopic): 501.2098AlogP: 2.71#Rotatable Bonds: 9Polar Surface Area: 100.78Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.55CX Basic pKa: 7.06CX LogP: 1.65CX LogD: 1.61Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -1.25
References 1. (2014) 8-azabicyclo[3.2.1]octane compounds as mu opioid receptor antagonists,